Feedback

2-(3-methylsulfanyl)propylmalate

PropertiesImageOccurences in reactions
MNX_IDMNXM3443Image of MNXM3443
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC8H12O5S
charge-2
mass220.24388
referencechebi:58817
InChIKeyWLOKFRZXOVZGIN-UHFFFAOYSA-L
InChIInChI=1S/C8H14O5S/c1-14-4-2-3-8(13,7(11)12)5-6(9)10/h13H,2-5H2,1H3,(H,9,10)(H,11,12)/p-2
SMILESCSCCCC(O)(CC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58817
chebi:58817
2-(3-methylsulfanyl)propylmalate
2-(3-methylthiopropyl)malate(2-)
2-hydroxy-2-[3-(methylsulfanyl)propyl]butanedioate
2-hydroxy-2-[3-(methylsulfanyl)propyl]succinate
seed.compound:cpd17404
seedM:cpd17404
2-(3'-Methylthio)propylmalate
2-(3'-Methylthio)propylmalic acid
2-(3'-methylthio)propylmalate
2-(3'-methylthio)propylmalic acid
2-[(3'-methylsulfanyl)propyl]malate
2-[(3'-methylthio)propyl]malate
2-[(3'-methylthio)propyl]malic acid
kegg.compound:C17214
keggC:C17214
2-(3'-Methylthio)propylmalic acid
2-(3'-Methylthio)propylmalate
CHEBI:50262
chebi:50262
2-(3-methylthiopropyl)malic acid
2-(3'-Methylthio)propylmalate
2-hydroxy-2-[3-(methylsulfanyl)propyl]butanedioic acid
MTPM
metacyc.compound:CPDQT-31
metacycM:CPDQT-31
2-[(3'-methylsulfanyl)propyl]malate
2-[(3'-methylthio)propyl]malate
2-[(3'-methylthio)propyl]malic acid
keggC:M_C17214
seedM:M_cpd17404
secondary/obsolete/fantasy identifier