|
|
|||||||||||||
| InChIKey | IKCLCGXPQILATA-UHFFFAOYSA-M |
| InChI | InChI=1S/C7H5ClO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10)/p-1 |
| SMILES | [O-]C(=O)c1ccccc1Cl |
| #reac | |
|---|---|
| Distinct reactions in my sandbox | 0 |
| Distinct generic reactions in MNXref | 3 |
| Distinct compatimentalized reactions in models | 0 |
| Identifier | Description |
|---|---|
| seedM:cpd01574 | 2-Chlorobenzoate 2-Chlorobenzoic acid 2-chlorobenzoate 2-chlorobenzoic acid o-Chlorobenzoic acid o-chlorobenzoic acid |
| chebi:28303 | 2-chlorobenzoate o-chlorobenzoate oCl-benzoate anion |
| keggC:C02357 sabiorkM:6159 | 2-Chlorobenzoate 2-Chlorobenzoic acid o-Chlorobenzoic acid |
| metacycM:CPD-256 | 2-chlorobenzoate 2-chlorobenzoic acid o-chlorobenzoic acid |
| envipath:...70f5c6084530 | M02 (2-chlorobenzoic acid) 2-Chlorobenzoic acid;AE C500233, 2-Chlorobenzoic acid ;M02 2-chlorobenzoic acid;M20 2-chlorobenzoic acid |
| envipath:...b014a130bc90 | 2-Chlorobenzoate |
| chebi:30793 | 2-chlorobenzoic acid 2-Chlorobenzoic acid o-Chlorobenzoic acid o-chlorobenzoic acid |
| envipath:...8592a0aa5803 | compound 990 |
| chebi:1043 chebi:11540 chebi:19505 chebi:19506 keggC:M_C02357 seedM:M_cpd01574 | secondary/obsolete/fantasy identifier |
| MNXM724503 | is deprecated and replaced by this entry |
| MNXM724926 | is deprecated and replaced by this entry |
