Feedback

2-chlorobenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3458Image of MNXM3458
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC7H4ClO2
charge-1
mass154.99053
referencechebi:28303
InChIKeyIKCLCGXPQILATA-UHFFFAOYSA-M
InChIInChI=1S/C7H5ClO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10)/p-1
SMILESO=C([O-])c1ccccc1Cl
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:28303
chebi:28303
2-chlorobenzoate
o-chlorobenzoate
oCl-benzoate anion
envipath:...b014a130bc90
envipathM:...b014a130bc90
2-Chlorobenzoate
seed.compound:cpd01574
seedM:cpd01574
2-Chlorobenzoate
2-Chlorobenzoic acid
2-chlorobenzoate
2-chlorobenzoic acid
o-Chlorobenzoic acid
o-chlorobenzoic acid
sabiork.compound:6159
sabiorkM:6159
kegg.compound:C02357
keggC:C02357
2-Chlorobenzoate
2-Chlorobenzoic acid
o-Chlorobenzoic acid
metacyc.compound:CPD-256
metacycM:CPD-256
2-chlorobenzoate
2-chlorobenzoic acid
o-chlorobenzoic acid
CHEBI:30793
chebi:30793
2-chlorobenzoic acid
2-Chlorobenzoic acid
o-Chlorobenzoic acid
o-chlorobenzoic acid
envipath:...70f5c6084530
envipathM:...70f5c6084530
M02 (2-chlorobenzoic acid)
2-Chlorobenzoic acid;AE C500233, 2-Chlorobenzoic acid ;M02 2-chlorobenzoic acid;M20 2-chlorobenzoic acid
envipath:...8592a0aa5803
envipathM:...8592a0aa5803
compound 990
chebi:1043
chebi:11540
chebi:19505
chebi:19506
keggC:M_C02357
seedM:M_cpd01574
secondary/obsolete/fantasy identifier