Feedback

2-hydroxy-6-(2-hydroxyphenoxy)-6-oxo-cis,cis-hexa-2,4-dienoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3463Image of MNXM3463
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC12H9O6
charge-1
mass249.19626
referencechebi:19327
InChIKeyCULGWEQEASHZHP-NINQLNBYSA-M
InChIInChI=1S/C12H10O6/c13-8-4-1-2-6-10(8)18-11(15)7-3-5-9(14)12(16)17/h1-7,13-14H,(H,16,17)/p-1/b7-3-,9-5+
SMILESO\C(=C\C=C/C(=O)Oc1ccccc1O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:19327
chebi:19327
2-hydroxy-6-(2-hydroxyphenoxy)-6-oxo-cis,cis-hexa-2,4-dienoate
(2E,4Z)-2-hydroxy-6-(2-hydroxyphenoxy)-6-oxohexa-2,4-dienoate
2-Hydroxy-6-oxo-6-(2-hydroxyphenoxy)-hexa-2,4-dienoate
2-Hydroxy-6-oxo-6-(2-hydroxyphenoxy)hexa-2,4-dienoate
kegg.compound:C07734
keggC:C07734
2-Hydroxy-6-oxo-6-(2-hydroxyphenoxy)-hexa-2,4-dienoate
seed.compound:cpd04868
seedM:cpd04868
2-Hydroxy-6-oxo-6-(2-hydroxyphenoxy)-hexa-2,4-dienoate
2,3-hydroxy-6-oxo-6-(2-hydroxyphenyl)-hexa-2,4-dienoate
2-hydroxy-6-(2-hydroxyphenoxy)-6-oxo-cis,cis-hexa-2,4-dienoate
6-(2-hydroxyphenoxy)-2-hydroxy-muconate
6-(2-hydroxyphenoxy)-2-hydroxy-muconic acid
envipath:...0cccaa2f7e3d
envipathM:...0cccaa2f7e3d
2-Hydroxy-6-oxo-6-(2-hydroxyphenoxy)hexa-2,4-dienoate
metacyc.compound:CPD-924
metacycM:CPD-924
2-hydroxy-6-(2-hydroxyphenoxy)-6-oxo-cis,cis-hexa-2,4-dienoate
2,3-hydroxy-6-oxo-6-(2-hydroxyphenyl)-hexa-2,4-dienoate
6-(2-hydroxyphenoxy)-2-hydroxy-muconate
6-(2-hydroxyphenoxy)-2-hydroxy-muconic acid
CHEBI:28990
chebi:28990
2-hydroxy-6-(2-hydroxyphenoxy)-6-oxo-cis,cis-hexa-2,4-dienoic acid
(2E,4Z)-2-hydroxy-6-(2-hydroxyphenoxy)-6-oxohexa-2,4-dienoic acid
chebi:1134
keggC:M_C07734
seedM:M_cpd04868
secondary/obsolete/fantasy identifier