Feedback

3,4-dihydroxymandelate

PropertiesImageOccurences in reactions
MNX_IDMNXM3473Image of MNXM3473
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 7
formulaC8H7O5
charge-1
mass183.13818
referencemetacycM:CPD-11879
InChIKeyRGHMISIYKIHAJW-SSDOTTSWSA-M
InChIInChI=1S/C8H8O5/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,9-11H,(H,12,13)/p-1/t7-/m1/s1
SMILESO[C@@H](C([O-])=O)c1ccc(O)c(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
metacyc.compound:CPD-11879
metacycM:CPD-11879
3,4-dihydroxymandelate
3,4-dihydroxymandelic acid
DHMA
dihydroxymandelic acid
mandelic acid, 3,4-dihydroxy-
bigg.metabolite:34dhoxmand
biggM:34dhoxmand
3,4-Dihydroxymandelate
kegg.compound:C05580
keggC:C05580
3,4-Dihydroxymandelate
3,4-Dihydroxymandelic acid
Dihydroxymandelic acid
hmdb:HMDB0001866 3,4-Dihydroxymandelic acid
(3,4-Dihydroxyphenyl)(hydroxy)acetate
(3,4-Dihydroxyphenyl)(hydroxy)acetic acid
2-(3,4-dihydroxyphenyl)-2-hydroxyacetic acid
3,4 Dihydroxymandelate
3,4 Dihydroxymandelic acid
3,4-Dihydroxymandelate
3,4-Dihydroxymandelic acid, (+-)-isomer
3,4-Dihydroxymandelic acid, (S)-isomer
3,4-Dihydroxymandelic acid, ion(1-)
3,4-Dihydroxymandelic acid, monosodium salt
3,4-Dihydroxyphenylglycolate
3,4-Dihydroxyphenylglycolic acid
DHMA
DOMA
Dihydroxymandelate
Dihydroxymandelic acid
dihydroxymandelic acid
sabiork.compound:26612
sabiorkM:26612
3,4-Dihydroxyphenylglycolate
(3,4-Dihydroxyphenyl)(hydroxy)acetate
CHEBI:53326
chebi:53326
3,4-dihydroxymandelate
(3,4-dihydroxyphenyl)(hydroxy)acetate
2-(3,4-dihydroxyphenyl)-2-hydroxyacetate
CHEBI:27637
chebi:27637
3,4-dihydroxymandelic acid
(3,4-dihydroxyphenyl)(hydroxy)acetic acid
2-(3,4-dihydroxyphenyl)-2-hydroxyacetic acid
3,4-Dihydroxymandelate
3,4-Dihydroxymandelic acid
3,4-Dihydroxyphenylglycolic acid
DOMA
Dihydroxymandelic acid
seed.compound:cpd03310
seedM:cpd03310
Dihydroxymandelic acid
3,4-Dihydroxymandelate
3,4-Dihydroxymandelic acid
3,4-dihydroxymandelate
3,4-dihydroxymandelic acid
DHMA
dihydroxymandelic acid
mandelic acid, 3,4-dihydroxy-
envipath:...d5790e05f0d6
envipathM:...d5790e05f0d6
compound 1288
hmdb:HMDB01866
chebi:1383
chebi:19884
biggM:M_34dhoxmand
keggC:M_C05580
seedM:M_cpd03310
secondary/obsolete/fantasy identifier