Feedback

3,4-dihydroxymandelate

Properties
MNX_IDMNXM3473
formulaC8H7O5
charge-1
mass183.13818
referencemetacycM:CPD-11879
Image of MNXM3473
InChIKeyRGHMISIYKIHAJW-SSDOTTSWSA-M
InChIInChI=1S/C8H8O5/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,9-11H,(H,12,13)/p-1/t7-/m1/s1
SMILESO[C@@H](C([O-])=O)c1ccc(O)c(O)c1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
metacycM:CPD-11879 3,4-dihydroxymandelate
3,4-dihydroxymandelic acid
DHMA
dihydroxymandelic acid
mandelic acid, 3,4-dihydroxy-
chebi:27637 3,4-dihydroxymandelic acid
(3,4-dihydroxyphenyl)(hydroxy)acetic acid
2-(3,4-dihydroxyphenyl)-2-hydroxyacetic acid
3,4-Dihydroxymandelate
3,4-Dihydroxymandelic acid
3,4-Dihydroxyphenylglycolic acid
DOMA
Dihydroxymandelic acid
chebi:53326 3,4-dihydroxymandelate
(3,4-dihydroxyphenyl)(hydroxy)acetate
2-(3,4-dihydroxyphenyl)-2-hydroxyacetate
hmdb:HMDB0001866 3,4-Dihydroxymandelic acid
(3,4-Dihydroxyphenyl)(hydroxy)acetate
(3,4-Dihydroxyphenyl)(hydroxy)acetic acid
2-(3,4-dihydroxyphenyl)-2-hydroxyacetic acid
3,4 Dihydroxymandelate
3,4 Dihydroxymandelic acid
3,4-Dihydroxymandelate
3,4-Dihydroxymandelic acid, (+-)-isomer
3,4-Dihydroxymandelic acid, (S)-isomer
3,4-Dihydroxymandelic acid, ion(1-)
3,4-Dihydroxymandelic acid, monosodium salt
3,4-Dihydroxyphenylglycolate
3,4-Dihydroxyphenylglycolic acid
DHMA
DOMA
Dihydroxymandelate
Dihydroxymandelic acid
dihydroxymandelic acid
sabiorkM:26612 3,4-Dihydroxyphenylglycolate
(3,4-Dihydroxyphenyl)(hydroxy)acetate
envipath:...d5790e05f0d6 compound 1288
keggC:C05580 3,4-Dihydroxymandelate
3,4-Dihydroxymandelic acid
Dihydroxymandelic acid
seedM:cpd03310 Dihydroxymandelic acid
3,4-Dihydroxymandelate
3,4-Dihydroxymandelic acid
3,4-dihydroxymandelate
3,4-dihydroxymandelic acid
DHMA
dihydroxymandelic acid
mandelic acid, 3,4-dihydroxy-
biggM:34dhoxmand 3,4-Dihydroxymandelate
biggM:M_34dhoxmand
chebi:1383
chebi:19884
hmdb:HMDB01866
keggC:M_C05580
seedM:M_cpd03310
secondary/obsolete/fantasy identifier
MNXM723774is deprecated and replaced by this entry
MNXM90911is deprecated and replaced by this entry