Feedback

3,4-dihydroxyphthalate

PropertiesImageOccurences in reactions
MNX_IDMNXM3474Image of MNXM3474
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC8H4O6
charge-2
mass196.00189
referencechebi:58137
InChIKeyQXGJCWSBOZXWOV-UHFFFAOYSA-L
InChIInChI=1S/C8H6O6/c9-4-2-1-3(7(11)12)5(6(4)10)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14)/p-2
SMILESO=C([O-])c1ccc(O)c(O)c1C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58137
chebi:58137
3,4-dihydroxyphthalate
3,4-dihydroxybenzene-1,3-dicarboxylate
3,4-dihydroxyphthalate dianion
3,4-dihydroxyphthalate(2-)
envipath:...2fe447fd726b
envipathM:...2fe447fd726b
3,4-Dihydroxyphthalate
kegg.compound:C03223
keggC:C03223
3,4-Dihydroxyphthalate
3,4-Dihydroxyphthalic acid
seed.compound:cpd02061
seedM:cpd02061
3,4-Dihydroxyphthalate
3,4-Dihydroxyphthalic acid
3,4-dihydroxyphthalate
metacyc.compound:CPD-635
metacycM:CPD-635
3,4-dihydroxyphthalate
CHEBI:17416
chebi:17416
3,4-dihydroxyphthalic acid
3,4-Dihydroxyphthalate
3,4-Dihydroxyphthalic acid
chebi:11699
chebi:1388
chebi:19892
keggC:M_C03223
seedM:M_cpd02061
secondary/obsolete/fantasy identifier