Feedback

3-(3,4-dihydroxyphenyl)propanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3476Image of MNXM3476
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 0
formulaC9H9O4
charge-1
mass181.05063
referencechebi:58744
InChIKeyDZAUWHJDUNRCTF-UHFFFAOYSA-M
InChIInChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13)/p-1
SMILESO=C([O-])CCc1ccc(O)c(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58744
chebi:58744
3-(3,4-dihydroxyphenyl)propanoate
hmdb:HMDB0000423 3,4-Dihydroxyhydrocinnamic acid
3,4-Dihydroxy-(6ci,7ci,8ci)hydrocinnamate
3,4-Dihydroxy-(6ci,7ci,8ci)hydrocinnamic acid
3,4-Dihydroxy-b-phenylpropionate
3,4-Dihydroxy-b-phenylpropionic acid
3,4-Dihydroxy-beta-phenylpropionate
3,4-Dihydroxy-beta-phenylpropionic acid
3,4-Dihydroxybenzenepropanoate
3,4-Dihydroxybenzenepropanoic acid
3,4-Dihydroxybenzenepropionate
3,4-Dihydroxybenzenepropionic acid
3,4-Dihydroxydihydrocinnamate
3,4-Dihydroxydihydrocinnamic acid
3,4-Dihydroxyhydrocinnamate
3,4-Dihydroxyphenylpropionate
3,4-Dihydroxyphenylpropionic acid
3,4-Dihydroxyphenylpropionic acid, potassium salt
3-(3,4-Dihydroxyphenyl)propanoate
3-(3,4-Dihydroxyphenyl)propanoic acid
3-(3,4-Dihydroxyphenyl)propionate
3-(3,4-Dihydroxyphenyl)propionic acid
3-(3,4-dihydroxyphenyl)propanoic acid
DHC
Dihydrocaffeate
Dihydrocaffeic acid
Hydrocaffeate
Hydrocaffeic acid
dihydrocaffeic acid
sabiork.compound:26803
sabiorkM:26803
3,4-Dihydroxyphenyl propionic acid
3,4-Dihydroxyphenylpropionate
3,4-Dihydroxyphenylpropionic acid
Dihydrocaffeic acid
kegg.compound:C10447
keggC:C10447
3,4-Dihydroxyphenylpropanoate
3,4-Dihydroxyphenylpropionic acid
3-(3,4-Dihydroxyphenyl)propanoate
Dihydrocaffeic acid
CHEBI:48400
chebi:48400
3-(3,4-dihydroxyphenyl)propanoic acid
3,4-dihydroxy-beta-phenylpropionic acid
3,4-dihydroxybenzenepropanoic acid
3,4-dihydroxybenzenepropionic acid
3,4-dihydroxydihydrocinnamic acid
3,4-dihydroxyhydrocinnamic acid
3,4-dihydroxyphenylpropionic acid
3-(3,4-dihydroxyphenyl)propionic acid
dihydrocaffeic acid
hydrocaffeic acid
seed.compound:cpd07333
seedM:cpd07333
Dihydrocaffeic acid
3,4-Dihydroxyphenylpropanoate
3,4-Dihydroxyphenylpropionic acid
3,4-dihydroxyphenylpropanoate
3,4-dihydroxyphenylpropionate
CPDIM-6116
hydrocaffeate
hydrocaffeic acid
sabiork.compound:20050
sabiorkM:20050
Hydrocaffeic acid
metacyc.compound:CPD-17463
metacycM:CPD-17463
hydrocaffeate
3,4-dihydroxyphenylpropanoate
hydrocaffeic acid
hmdb:HMDB00423
chebi:4556
keggC:M_C10447
seedM:M_cpd07333
secondary/obsolete/fantasy identifier