Feedback

3-(3,4-dihydroxyphenyl)propanoate

Properties
MNX_IDMNXM3476
formulaC9H9O4
charge-1
mass181.16536
referencechebi:58744
Image of MNXM3476
InChIKeyDZAUWHJDUNRCTF-UHFFFAOYSA-M
InChIInChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13)/p-1
SMILESOc1ccc(CCC([O-])=O)cc1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref8
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
metacycM:CPD-17463 hydrocaffeate
3,4-dihydroxyphenylpropanoate
hydrocaffeic acid
chebi:58744 3-(3,4-dihydroxyphenyl)propanoate
sabiorkM:20050 Hydrocaffeic acid
chebi:48400 3-(3,4-dihydroxyphenyl)propanoic acid
3,4-dihydroxy-beta-phenylpropionic acid
3,4-dihydroxybenzenepropanoic acid
3,4-dihydroxybenzenepropionic acid
3,4-dihydroxydihydrocinnamic acid
3,4-dihydroxyhydrocinnamic acid
3,4-dihydroxyphenylpropionic acid
3-(3,4-dihydroxyphenyl)propionic acid
dihydrocaffeic acid
hydrocaffeic acid
chebi:4556
hmdb:HMDB00423
keggC:M_C10447
seedM:M_cpd07333
secondary/obsolete/fantasy identifier
sabiorkM:26803 3,4-Dihydroxyphenyl propionic acid
3,4-Dihydroxyphenylpropionate
3,4-Dihydroxyphenylpropionic acid
Dihydrocaffeic acid
seedM:cpd07333 Dihydrocaffeic acid
3,4-Dihydroxyphenylpropanoate
3,4-Dihydroxyphenylpropionic acid
3,4-dihydroxyphenylpropanoate
3,4-dihydroxyphenylpropionate
CPDIM-6116
hydrocaffeate
hydrocaffeic acid
hmdb:HMDB0000423 3,4-Dihydroxyhydrocinnamic acid
3,4-Dihydroxy-(6ci,7ci,8ci)hydrocinnamate
3,4-Dihydroxy-(6ci,7ci,8ci)hydrocinnamic acid
3,4-Dihydroxy-b-phenylpropionate
3,4-Dihydroxy-b-phenylpropionic acid
3,4-Dihydroxy-beta-phenylpropionate
3,4-Dihydroxy-beta-phenylpropionic acid
3,4-Dihydroxybenzenepropanoate
3,4-Dihydroxybenzenepropanoic acid
3,4-Dihydroxybenzenepropionate
3,4-Dihydroxybenzenepropionic acid
3,4-Dihydroxydihydrocinnamate
3,4-Dihydroxydihydrocinnamic acid
3,4-Dihydroxyhydrocinnamate
3,4-Dihydroxyphenylpropionate
3,4-Dihydroxyphenylpropionic acid
3,4-Dihydroxyphenylpropionic acid, potassium salt
3-(3,4-Dihydroxyphenyl)propanoate
3-(3,4-Dihydroxyphenyl)propanoic acid
3-(3,4-Dihydroxyphenyl)propionate
3-(3,4-Dihydroxyphenyl)propionic acid
3-(3,4-dihydroxyphenyl)propanoic acid
Dihydrocaffeate
Dihydrocaffeic acid
Hydrocaffeate
Hydrocaffeic acid
dihydrocaffeic acid
keggC:C10447 3,4-Dihydroxyphenylpropanoate
3,4-Dihydroxyphenylpropionic acid
3-(3,4-Dihydroxyphenyl)propanoate
Dihydrocaffeic acid
MNXM481996is deprecated and replaced by this entry