Feedback

3-carboxy-1-hydroxypropylthiamine diphosphate

PropertiesImageOccurences in reactions
MNX_IDMNXM3480Image of MNXM3480
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 5
formulaC16H22N4O10P2S
charge-2
mass524.380362
referencechebi:1463
InChIKeyZWUKRGPVMMTMAF-UHFFFAOYSA-L
InChIInChI=1S/C16H24N4O10P2S/c1-9-13(5-6-29-32(27,28)30-31(24,25)26)33-16(12(21)3-4-14(22)23)20(9)8-11-7-18-10(2)19-15(11)17/h7,12,21H,3-6,8H2,1-2H3,(H5-,17,18,19,22,23,24,25,26,27,28)/p-2
SMILESCc1c(CCOP([O-])(=O)OP(O)([O-])=O)sc(C(O)CCC([O-])=O)[n+]1Cc1cnc(C)nc1N
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:1463
chebi:1463
3-carboxy-1-hydroxypropylthiamine diphosphate
2-(3-carboxy-1-hydroxypropyl)thiamine diphosphate
3-Carboxy-1-hydroxypropyl-ThPP
3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-(3-carboxy-1-hydroxypropyl)-5-(2-diphosphoethyl)-4-methyl-1,3-thiazol-3-ium
bigg.metabolite:HC01435
biggM:HC01435
sabiork.compound:2784
sabiorkM:2784
seed.compound:cpd03189
seedM:cpd03189
3-Carboxy-1-hydroxypropyl-ThPP
kegg.compound:C05381
keggC:C05381
3-Carboxy-1-hydroxypropyl-ThPP
Succinate semialdehyde-thiamin diphosphate
hmdb:HMDB0006744 3-Carboxy-1-hydroxypropylthiamine diphosphate
2-(3-Carboxy-1-hydroxypropyl)thiamine diphosphate
2-(3-Carboxy-1-hydroxypropyl)thiamine diphosphoric acid
3-Carboxy-1-hydroxypropyl-THPP
3-Carboxy-1-hydroxypropylthiamine diphosphoric acid
3-[(4-amino-2-Methylpyrimidin-5-yl)methyl]-2-(3-carboxy-1-hydroxypropyl)-5-(2-diphosphoethyl)-4-methyl-1,3-thiazol-3-ium
3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-(3-carboxy-1-hydroxypropyl)-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-4-methyl-1,3-thiazol-3-ium
3-carboxy-1-hydroxypropyl-thpp
hmdb:HMDB06744
biggM:M_HC01435
keggC:M_C05381
seedM:M_cpd03189
secondary/obsolete/fantasy identifier