Feedback
(Z)-1,2-ethenediol
MNXM349 is deprecated and here replaced by MNXM734589
!!! Alternative mappings exist !!!
| Properties | Image |
| MNX_ID | MNXM734589 |
 |
| reference | chebi:131198 |
| formula | C2H4O2 |
| global charge | 0 |
| mol weight | 60.052 |
| InChIKey | JMCRDEBJJPRTPV-UPHRSURJSA-N |
| InChI | InChI=1S/C2H4O2/c3-1-2-4/h1-4H/b2-1- |
| SMILES | O/C=C\O |
MNX internals
| InChI (mnx) | InChI=1/C2H4O2/c3-1-2-4/h1-4H/b2-1- |
 |
| SMILES (mnx) | [CH:1](=[CH:2]\[OH:4])\[OH:3] |
|
| Parent-child relations graph |
| Occurences in reactions | #reac |
| in my sandbox |
0 |
| in MNXref (generic) | 0 |
| in models (compartimentalized) |
0 |
|
Similar chemical compounds in external resources
| Identifier | Description |
CHEBI:131198 chebi:131198 JMCRDEBJJPRTPV-UPHRSURJSA-N
| (Z)-1,2-ethenediol (Z)-ethene-1,2-diol cis-1,2-Ethenediol
|