Feedback

4-Methylene-2-oxoglutarate

PropertiesImageOccurences in reactions
MNX_IDMNXM3498Image of MNXM3498
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC6H4O5
charge-2
mass156.09296
referencechebi:1898
InChIKeyOARCEFMISOKEKI-UHFFFAOYSA-L
InChIInChI=1S/C6H6O5/c1-3(5(8)9)2-4(7)6(10)11/h1-2H2,(H,8,9)(H,10,11)/p-2
SMILES[O-]C(=O)C(=C)CC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:1898
chebi:1898
kegg.compound:C06035
keggC:C06035
4-Methylene-2-oxoglutarate
2-Methylidene-4-oxopentanedioic acid
4-Carboxy-2-oxo-4-pentenoate
hmdb:HMDB0037759 2-Methylene-4-oxopentanedioic acid
2-Methylene-4-oxoglutaric acid
2-Methylene-4-oxopentanedioate
2-Methylidene-4-oxopentanedioate
2-Methylidene-4-oxopentanedioic acid
2-methylidene-4-oxopentanedioic acid
4-Carboxy-2-oxo-4-pentenoate
4-Carboxy-2-oxo-4-pentenoic acid
4-methylene-2-oxoglutarate
g-Methylene-a-ketoglutaric acid
lipidmaps:LMFA01170047
lipidmapsM:LMFA01170047
2-methylene-4-oxo-pentanedioic acid
2-methylene-4-oxo-pentanedioic acid
metacyc.compound:CPD-88
metacycM:CPD-88
2-oxo-4-carboxypent-4-enoate
seed.compound:cpd03596
seedM:cpd03596
4-Methylene-2-oxoglutarate
2-Methylidene-4-oxopentanedioic acid
2-oxo-4-carboxypent-4-enoate
4-Carboxy-2-oxo-4-pentenoate
envipath:...865986dc7a29
envipathM:...865986dc7a29
compound 37925
hmdb:HMDB37759
keggC:M_C06035
seedM:M_cpd03596
secondary/obsolete/fantasy identifier