Feedback

5,6-dihydroxy-3-methyl-5,6-dihydroquinolin-2(1H)-one

Properties
MNX_IDMNXM3501
formulaC10H11NO3
charge0
mass193.19928
referencechebi:17143
Image of MNXM3501
InChIKeySQVOTYNRTIAIBT-UHFFFAOYSA-N
InChIInChI=1S/C10H11NO3/c1-5-4-6-7(11-10(5)14)2-3-8(12)9(6)13/h2-4,8-9,12-13H,1H3,(H,11,14)
SMILESCc1cc2C(O)C(O)C=Cc2[nH]c1=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:17143 5,6-dihydroxy-3-methyl-5,6-dihydroquinolin-2(1H)-one
5,6-Dihydroxy-3-methyl-2-oxo-1,2,5,6-tetrahydroquinoline
metacycM:CPD-981 5,6-dihydrodiol-3-methyl-2-oxo-1,2-dihydroquinoline
5,6-dihydroxy-3-methyl-1,5,6-trihydroquinolin-2-one
5,6-dihydroxy-3-methyl-2-oxo-1,2,5,6-tetrahydroquinoline
chebi:12079
chebi:2000
chebi:20509
chebi:20512
keggC:M_C06726
seedM:M_cpd04113
secondary/obsolete/fantasy identifier
keggC:C06726 5,6-Dihydroxy-3-methyl-2-oxo-1,2,5,6-tetrahydroquinoline
seedM:cpd04113 5,6-Dihydroxy-3-methyl-2-oxo-1,2,5,6-tetrahydroquinoline
5,6-dihydrodiol-3-methyl-2-oxo-1,2-dihydroquinoline
5,6-dihydroxy-3-methyl-1,5,6-trihydroquinolin-2-one
5,6-dihydroxy-3-methyl-2-oxo-1,2,5,6-tetrahydroquinoline