Feedback

5,6-dihydroxy-3-methyl-5,6-dihydroquinolin-2(1H)-one

PropertiesImageOccurences in reactions
MNX_IDMNXM3501Image of MNXM3501
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC10H11NO3
charge0
mass193.19928
referencechebi:17143
InChIKeySQVOTYNRTIAIBT-UHFFFAOYSA-N
InChIInChI=1S/C10H11NO3/c1-5-4-6-7(11-10(5)14)2-3-8(12)9(6)13/h2-4,8-9,12-13H,1H3,(H,11,14)
SMILESCc1cc2C(O)C(O)C=Cc2[nH]c1=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17143
chebi:17143
5,6-dihydroxy-3-methyl-5,6-dihydroquinolin-2(1H)-one
5,6-Dihydroxy-3-methyl-2-oxo-1,2,5,6-tetrahydroquinoline
kegg.compound:C06726
keggC:C06726
5,6-Dihydroxy-3-methyl-2-oxo-1,2,5,6-tetrahydroquinoline
seed.compound:cpd04113
seedM:cpd04113
5,6-Dihydroxy-3-methyl-2-oxo-1,2,5,6-tetrahydroquinoline
5,6-dihydrodiol-3-methyl-2-oxo-1,2-dihydroquinoline
5,6-dihydroxy-3-methyl-1,5,6-trihydroquinolin-2-one
5,6-dihydroxy-3-methyl-2-oxo-1,2,5,6-tetrahydroquinoline
metacyc.compound:CPD-981
metacycM:CPD-981
5,6-dihydrodiol-3-methyl-2-oxo-1,2-dihydroquinoline
5,6-dihydroxy-3-methyl-1,5,6-trihydroquinolin-2-one
5,6-dihydroxy-3-methyl-2-oxo-1,2,5,6-tetrahydroquinoline
chebi:12079
chebi:2000
chebi:20509
chebi:20512
keggC:M_C06726
seedM:M_cpd04113
secondary/obsolete/fantasy identifier