Feedback

5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline

PropertiesImageOccurences in reactions
MNX_IDMNXM3502Image of MNXM3502
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC10H9NO3
charge0
mass191.1834
referencechebi:16937
InChIKeyIYHQVDIUZANYNW-UHFFFAOYSA-N
InChIInChI=1S/C10H9NO3/c1-5-4-6-7(11-10(5)14)2-3-8(12)9(6)13/h2-4,12-13H,1H3,(H,11,14)
SMILESCc1cc2c(O)c(O)ccc2[nH]c1=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16937
chebi:16937
5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline
5,6-Dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline
5,6-dihydroxy-3-methylquinolin-2(1H)-one
envipath:...5866f593894e
envipathM:...5866f593894e
kegg.compound:C06725
keggC:C06725
5,6-Dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline
seed.compound:cpd04112
seedM:cpd04112
5,6-Dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline
5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline
5,6-dihydroxy-3-methylhydroquinolin-2-one
metacyc.compound:CPD-982
metacycM:CPD-982
5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline
5,6-dihydroxy-3-methylhydroquinolin-2-one
chebi:12080
chebi:2001
chebi:20513
keggC:M_C06725
seedM:M_cpd04112
secondary/obsolete/fantasy identifier