Feedback

5,6alpha-epoxy-5alpha-cholestan-3beta-ol

PropertiesImageOccurences in reactions
MNX_IDMNXM3503Image of MNXM3503
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC27H46O2
charge0
mass402.65294
referencechebi:49305
InChIKeyPRYIJAGAEJZDBO-ZEQHCUNVSA-N
InChIInChI=1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-20-15-24-27(29-24)16-19(28)11-14-26(27,5)23(20)12-13-25(21,22)4/h17-24,28H,6-16H2,1-5H3/t18-,19+,20+,21-,22+,23+,24+,25-,26-,27+/m1/s1
SMILESCC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H]4O[C@@]44C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:49305
chebi:49305
5,6alpha-epoxy-5alpha-cholestan-3beta-ol
5,6alpha epoxy-cholesterol
5,6alpha-Epoxy-5alpha-cholestan-3beta-ol
5-alpha,6-alpha-Epoxycholestanol
Cholesterol alpha-oxide
Cholesterol-5alpha,6alpha-epoxide
Cholesterol-alpha-epoxide
lipidmaps:LMST01010011
lipidmapsM:LMST01010011
5,6alpha-epoxy-cholesterol
5,6alpha-epoxy-cholestanol
5alpha,6alpha-epoxy-5alpha-cholestan-3beta-ol
metacyc.compound:CPD-8895
metacycM:CPD-8895
5alpha,6alpha-epoxycholesterol
5,6-alpha-epoxy-5-alpha-cholestan-3-beta-ol
cholesterol-5alpha,6alpha-epoxide
seed.compound:cpd14716
seedM:cpd14716
Cholesterol-5alpha,6alpha-epoxide
5,6-alpha-epoxy-5-alpha-cholestan-3-beta-ol
5,6alpha-Epoxy-5alpha-cholestan-3beta-ol
kegg.compound:C15992
keggC:C15992
Cholesterol-5alpha,6alpha-epoxide
5,6alpha-Epoxy-5alpha-cholestan-3beta-ol
keggC:M_C15992
seedM:M_cpd14716
secondary/obsolete/fantasy identifier