Feedback

(E)-5-hydroxyferulate

Properties
MNX_IDMNXM3507
formulaC10H9O5
charge-1
mass209.17546
referencechebi:144381
Image of MNXM3507
InChIKeyYFXWTVLDSKSYLW-NSCUHMNNSA-M
InChIInChI=1S/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13)/p-1/b3-2+
SMILESCOc1cc(\C=C\C([O-])=O)cc(O)c1O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models2

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd03337 5-Hydroxyferulate
5-Hydroxyferulic acid methyl ester
5-hydroxy ferulic acid
5-hydroxyferulate
chebi:20582 5-hydroxyferulic acid
3,4-dihydroxy-5-methoxycinnamic acid
3-(3,4-dihydroxy-5-methoxyphenyl)-2-propenoic acid
3-(3,4-dihydroxy-5-methoxyphenyl)acrylic acid
3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
3-methoxycaffeic acid
keggC:C05619 5-Hydroxyferulic acid methyl ester
hmdb:HMDB0127490 3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
3,4-Dihydroxy-5-methoxycinnamate
3,4-Dihydroxy-5-methoxycinnamic acid
3-(3,4-Dihydroxy-5-methoxyphenyl)-2-propenoate
3-(3,4-Dihydroxy-5-methoxyphenyl)-2-propenoic acid
3-(3,4-Dihydroxy-5-methoxyphenyl)acrylate
3-(3,4-Dihydroxy-5-methoxyphenyl)acrylic acid
5-Hydroxyferulate
5-hydroxyferulic acid
hmdb:HMDB0035484 3-(3,4-Dihydroxy-5-methoxy)-2-propenoic acid
(2E)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
3,4-Dihydroxy-5-methoxycinnamoic acid
3-(3,4-Dihydroxy-5-methoxy)-2-propenoic acid, 9ci
3-(3,4-Dihydroxy-5-methoxyphenyl)-2-propenoic acid
3-Methoxycaffeic acid
5-Hydroxyferulate
5-Hydroxyferulic acid
5-hydroxyferulate
HFL
metacycM:5-HYDROXY-FERULIC-ACID 5-hydroxyferulate
5-hydroxy ferulic acid
chebi:144056 5-hydroxyferulate
3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoate
5-hydroxyferulic acid(1-)
chebi:2069 (E)-5-hydroxyferulic acid
(2E)-3-(3,4-dihydroxy-5-methoxyphenyl)-2-propenoic acid
(2E)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
3-methoxy-4,5-dihydroxy-trans-cinnamic acid
trans-5-hydroxyferulic acid
sabiorkM:8014 5-Hydroxyferulate
chebi:144381 (E)-5-hydroxyferulate
(2E)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoate
hmdb:HMDB35484
keggC:M_C05619
seedM:M_cpd03337
secondary/obsolete/fantasy identifier
MNXM482503is deprecated and replaced by this entry