Feedback

(E)-5-hydroxyferulate

PropertiesImageOccurences in reactions
MNX_IDMNXM3507Image of MNXM3507
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 2
formulaC10H9O5
charge-1
mass209.17546
referencechebi:144381
InChIKeyYFXWTVLDSKSYLW-NSCUHMNNSA-M
InChIInChI=1S/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13)/p-1/b3-2+
SMILESCOc1cc(\C=C\C([O-])=O)cc(O)c1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:144381
chebi:144381
(E)-5-hydroxyferulate
(2E)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoate
CHEBI:2069
chebi:2069
(E)-5-hydroxyferulic acid
(2E)-3-(3,4-dihydroxy-5-methoxyphenyl)-2-propenoic acid
(2E)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
3-methoxy-4,5-dihydroxy-trans-cinnamic acid
trans-5-hydroxyferulic acid
hmdb:HMDB0035484 3-(3,4-Dihydroxy-5-methoxy)-2-propenoic acid
(2E)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
3,4-Dihydroxy-5-methoxycinnamoic acid
3-(3,4-Dihydroxy-5-methoxy)-2-propenoic acid, 9ci
3-(3,4-Dihydroxy-5-methoxyphenyl)-2-propenoic acid
3-Methoxycaffeic acid
5-Hydroxyferulate
5-Hydroxyferulic acid
5-hydroxyferulate
HFL
hmdb:HMDB0127490 3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
3,4-Dihydroxy-5-methoxycinnamate
3,4-Dihydroxy-5-methoxycinnamic acid
3-(3,4-Dihydroxy-5-methoxyphenyl)-2-propenoate
3-(3,4-Dihydroxy-5-methoxyphenyl)-2-propenoic acid
3-(3,4-Dihydroxy-5-methoxyphenyl)acrylate
3-(3,4-Dihydroxy-5-methoxyphenyl)acrylic acid
5-Hydroxyferulate
5-hydroxyferulic acid
sabiork.compound:8014
sabiorkM:8014
5-Hydroxyferulate
seed.compound:cpd03337
seedM:cpd03337
5-Hydroxyferulate
5-Hydroxyferulic acid methyl ester
5-hydroxy ferulic acid
5-hydroxyferulate
kegg.compound:C05619
keggC:C05619
5-Hydroxyferulic acid methyl ester
CHEBI:144056
chebi:144056
5-hydroxyferulate
3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoate
5-hydroxyferulic acid(1-)
metacyc.compound:5-HYDROXY-FERULIC-ACID
metacycM:5-HYDROXY-FERULIC-ACID
5-hydroxyferulate
5-hydroxy ferulic acid
CHEBI:20582
chebi:20582
5-hydroxyferulic acid
3,4-dihydroxy-5-methoxycinnamic acid
3-(3,4-dihydroxy-5-methoxyphenyl)-2-propenoic acid
3-(3,4-dihydroxy-5-methoxyphenyl)acrylic acid
3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
3-methoxycaffeic acid
hmdb:HMDB35484
keggC:M_C05619
seedM:M_cpd03337
secondary/obsolete/fantasy identifier