Feedback

5-oxo-D-proline

Properties
MNX_IDMNXM3511
formulaC5H6NO3
charge-1
mass128.10608
referencechebi:57948
Image of MNXM3511
InChIKeyODHCTXKNWHHXJC-GSVOUGTGSA-M
InChIInChI=1S/C5H7NO3/c7-4-2-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/p-1/t3-/m1/s1
SMILES[O-]C(=O)[C@H]1CCC(=O)N1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref1
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd01512 5-Oxo-D-proline
5-oxo-D-proline
D-5-Pyrrolidone-2-carboxylic acid
D-Pyroglutamic acid
chebi:16924 5-oxo-D-proline
(2R)-5-oxopyrrolidine-2-carboxylic acid
5-Oxo-D-proline
D-5-Pyrrolidone-2-carboxylic acid
D-Pyroglutamic acid
chebi:12152
chebi:20618
chebi:2112
keggC:M_C02237
seedM:M_cpd01512
secondary/obsolete/fantasy identifier
chebi:57948 5-oxo-D-proline
(2R)-5-oxopyrrolidine-2-carboxylate
5-oxo-D-prolinate
5-oxo-D-prolinate anion
5-oxo-D-prolinate(1-)
keggC:C02237 5-Oxo-D-proline
D-5-Pyrrolidone-2-carboxylic acid
D-Pyroglutamic acid
metacycM:CPD-656 5-oxo-D-proline
D-5-Pyrrolidone-2-carboxylic acid
D-Pyroglutamic acid