Feedback

acetylsalicylate

PropertiesImageOccurences in reactions
MNX_IDMNXM3526Image of MNXM3526
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC9H7O4
charge-1
mass179.03498
referencechebi:13719
InChIKeyBSYNRYMUTXBXSQ-UHFFFAOYSA-M
InChIInChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/p-1
SMILESCC(=O)Oc1ccccc1C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-2314693
reactomeM:R-ALL-2314693
CHEBI:13719
chebi:13719
acetylsalicylate
2-(acetyloxy)benzoate
kegg.drug:D00109
keggD:D00109
Aspirin (JP18/USP)
Acetylsalicylic acid
Aspalon (JAN)
Durlaza (TN)
Easprin (TN)
hmdb:HMDB0001879 Aspirin
2-(ACETYLOXY)benzoIC ACID
2-(ACETYLOXY)benzoate
2-(acetyloxy)benzoic acid
2-Acetoxybenzenecarboxylate
2-Acetoxybenzenecarboxylic acid
2-Acetoxybenzoate
2-Acetoxybenzoic acid
2-Carboxyphenyl acetate
ASA
Acenterine
Acetard
Aceticyl
Acetol
Acetonyl
Acetophen
Acetosal
Acetosalin
Acetylin
Acetylsalicylate
Acetylsalicylic acid
Acetylsalicylsaeure
Acetyonyl
Acetysal
Acetysalicylic acid
Acid, acetylsalicylic
Acide 2-(acetyloxy)benzoique
Acide acetylsalicylique
Acido acetilsalicilico
Acidum acetylsalicylicum
Acylpyrin
Aloxiprimum
Asatard
Aspalon
Aspergum
Aspirdrops
Azetylsalizylsaeure
Benaspir
Bialpirinia
Bufferin
Caprin
Cardioaspirina
Colfarit
Dispril
Durlaza
Easprin
Ecolen
Ecotrin
Empirin
Endosprin
Endydol
Magnecyl
Micristin
O-(Acetyloxy)benzoate
O-(Acetyloxy)benzoic acid
O-Acetoxybenzoate
O-Acetoxybenzoic acid
O-Acetylsalicylate
O-Acetylsalicylic acid
O-Carboxyphenyl acetate
O-Carboxyphenyl acetic acid
Persistin
Pharmacin
Polopirin
Polopiryna
Premaspin
Rheumintabletten
Rhodine
Salcetogen
Saletin
Salicylate acetate
Salicylic acid acetate
Salicylic acid acetic acid
Salospir
Solprin
Solprin acid
Solpyron
Solupsan
Tasprin
Temperal
Toldex
Triaminicin
Zorprin
aspirin
seed.compound:cpd01006
seedM:cpd01006
Aspirin
2-Acetoxybenzenecarboxylic acid
2-acetoxybenzenecarboxylic acid
Acetylsalicylate
Acetylsalicylic acid
CPDIM-6114
acetylsalicylate
acetylsalicylic acid
aspirin
kegg.compound:C01405
keggC:C01405
Aspirin
2-Acetoxybenzenecarboxylic acid
Acetylsalicylate
Acetylsalicylic acid
CHEBI:15365
chebi:15365
acetylsalicylic acid
2-(ACETYLOXY)BENZOIC ACID
2-(acetyloxy)benzoic acid
2-Acetoxybenzenecarboxylic acid
2-acetoxybenzoic acid
ASA
Acetylsalicylate
Acetylsalicylic acid
Acetylsalicylsaeure
Aspirin
Azetylsalizylsaeure
Easprin
O-acetylsalicylic acid
acide 2-(acetyloxy)benzoique
acide acetylsalicylique
acido acetilsalicilico
acidum acetylsalicylicum
o-acetoxybenzoic acid
o-carboxyphenyl acetate
salicylic acid acetate
metacyc.compound:CPD-524
metacycM:CPD-524
aspirin
2-acetoxybenzenecarboxylic acid
acetylsalicylate
acetylsalicylic acid
hmdb:HMDB01879
chebi:22188
chebi:22203
chebi:2890
chebi:40705
chebi:71414
keggC:M_C01405
keggD:M_D00109
seedM:M_cpd01006
secondary/obsolete/fantasy identifier