Feedback

acetylsalicylate

Properties
MNX_IDMNXM3526
formulaC9H7O4
charge-1
mass179.14948
referencechebi:13719
Image of MNXM3526
InChIKeyBSYNRYMUTXBXSQ-UHFFFAOYSA-M
InChIInChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/p-1
SMILESCC(=O)Oc1ccccc1C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref5
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd01006 Aspirin
2-Acetoxybenzenecarboxylic acid
2-acetoxybenzenecarboxylic acid
Acetylsalicylate
Acetylsalicylic acid
CPDIM-6114
acetylsalicylate
acetylsalicylic acid
aspirin
metacycM:CPD-524 aspirin
2-acetoxybenzenecarboxylic acid
acetylsalicylate
acetylsalicylic acid
hmdb:HMDB0001879 Aspirin
2-(ACETYLOXY)benzoIC ACID
2-(ACETYLOXY)benzoate
2-(acetyloxy)benzoic acid
2-Acetoxybenzenecarboxylate
2-Acetoxybenzenecarboxylic acid
2-Acetoxybenzoate
2-Acetoxybenzoic acid
2-Carboxyphenyl acetate
ASA
Acenterine
Acetard
Aceticyl
Acetol
Acetonyl
Acetophen
Acetosal
Acetosalin
Acetylin
Acetylsalicylate
Acetylsalicylic acid
Acetylsalicylsaeure
Acetyonyl
Acetysal
Acetysalicylic acid
Acid, acetylsalicylic
Acide 2-(acetyloxy)benzoique
Acide acetylsalicylique
Acidum acetylsalicylicum
Acylpyrin
Aloxiprimum
Asatard
Aspergum
Aspirdrops
Azetylsalizylsaeure
Benaspir
Bialpirinia
Bufferin
Caprin
Cardioaspirina
Colfarit
Dispril
Easprin
Ecolen
Ecotrin
Empirin
Endosprin
Endydol
Magnecyl
Micristin
O-(Acetyloxy)benzoate
O-(Acetyloxy)benzoic acid
O-Acetoxybenzoate
O-Acetoxybenzoic acid
O-Acetylsalicylate
O-Acetylsalicylic acid
O-Carboxyphenyl acetate
O-Carboxyphenyl acetic acid
Persistin
Pharmacin
Polopirin
Polopiryna
Premaspin
Rheumintabletten
Rhodine
Salcetogen
Saletin
Salicylate acetate
Salicylic acid acetate
Salicylic acid acetic acid
Salospir
Solprin
Solprin acid
Solpyron
Solupsan
Tasprin
Temperal
Toldex
Triaminicin
Zorprin
acido Acetilsalicilico
aspirin
chebi:13719
reactome:R-ALL-2314693
acetylsalicylate
2-(acetyloxy)benzoate
chebi:15365 acetylsalicylic acid
2-(ACETYLOXY)BENZOIC ACID
2-(acetyloxy)benzoic acid
2-Acetoxybenzenecarboxylic acid
2-acetoxybenzoic acid
ASA
Acetylsalicylate
Acetylsalicylic acid
Acetylsalicylsaeure
Aspirin
Azetylsalizylsaeure
Easprin
O-acetylsalicylic acid
acide 2-(acetyloxy)benzoique
acide acetylsalicylique
acido acetilsalicilico
acidum acetylsalicylicum
o-acetoxybenzoic acid
o-carboxyphenyl acetate
salicylic acid acetate
keggC:C01405 Aspirin
2-Acetoxybenzenecarboxylic acid
Acetylsalicylate
Acetylsalicylic acid
chebi:22188
chebi:22203
chebi:2890
chebi:40705
chebi:71414
hmdb:HMDB01879
keggC:M_C01405
keggD:M_D00109
seedM:M_cpd01006
secondary/obsolete/fantasy identifier
keggD:D00109 Aspirin (JP17/USP)
Acetylsalicylic acid
Aspalon (JAN)
Durlaza (TN)
Easprin (TN)