Feedback

L-homoserine

PropertiesImageOccurences in reactions
MNX_IDMNXM353Image of MNXM353
#reac
in my sandbox 0
in MNXref (generic)82
in models (compartimentalized) 138
formulaC4H9NO3
charge0
mass119.05824
referencechebi:57476
InChIKeyUKAUYVFTDYCKQA-VKHMYHEASA-N
InChIInChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1
SMILES[NH3+][C@@H](CCO)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57476
chebi:57476
L-homoserine
(2S)-2-ammonio-4-hydroxybutanoate
(2S)-2-azaniumyl-4-hydroxybutanoate
L-homoserine zwitterion
bigg.metabolite:hom__L
biggM:hom__L
L-Homoserine
hmdb:HMDB0000719 L-Homoserine
(2S)-2-Amino-4-hydroxybutanoate
(2S)-2-Amino-4-hydroxybutanoic acid
(2S)-2-amino-4-hydroxybutanoic acid
(S)-2-Amino-4-hydroxy-butanoate
(S)-2-Amino-4-hydroxy-butanoic acid
(S)-2-Amino-4-hydroxybutanoate
(S)-2-Amino-4-hydroxybutanoic acid
(S)-Homoserine
2-Amino-4-hydroxy-L-butyrate
2-Amino-4-hydroxy-L-butyric acid
2-Amino-4-hydroxy-butyrate
2-Amino-4-hydroxy-butyric acid
2-Amino-4-hydroxybutanoate
2-Amino-4-hydroxybutanoic acid
2-Amino-4-hydroxybutyrate
2-Amino-4-hydroxybutyric acid
Homoserine
Homoserine L-isomer
L Isomer OF homoserine
L-Isomer OF homoserine
L-homoserine
sabiork.compound:2001
sabiorkM:2001
kegg.compound:C00263
keggC:C00263
L-Homoserine
2-Amino-4-hydroxybutyric acid
seed.compound:cpd00227
seedM:cpd00227
L-Homoserine
2-Amino-4-hydroxybutyric acid
2-amino-4-hydroxybutanoate
2-amino-4-hydroxybutanoic acid
L-homoserine
hom-L
homo-ser
homoserine
CHEBI:15699
chebi:15699
L-homoserine
(2S)-2-amino-4-hydroxybutanoic acid
2-Amino-4-hydroxybutanoic acid
2-Amino-4-hydroxybutyric acid
Homoserine
L-HOMOSERINE
L-Homoserine
metacyc.compound:HOMO-SER
metacycM:HOMO-SER
L-homoserine
2-amino-4-hydroxybutanoate
2-amino-4-hydroxybutanoic acid
homo-ser
homoserine
hmdb:HMDB00719
chebi:13123
chebi:21330
chebi:43131
chebi:6246
biggM:M_hom__L
keggC:M_C00263
seedM:M_cpd00227
secondary/obsolete/fantasy identifier