|
![]() |
InChIKey | USBNIYMZDQVDSO-UHFFFAOYSA-N |
InChI | InChI=1S/C12H10O3/c13-10-6-2-1-4-8(10)9-5-3-7-11(14)12(9)15/h1-7,13-15H |
SMILES | Oc1cccc(c1O)-c1ccccc1O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 5 |
Distinct compatimentalized reactions in models | 0 |
Identifier | Description |
---|---|
envipath:...ee2334c0673a | 2,2`,3-Trihydroxybiphenyl |
metacycM:CPD-927 | 2,2',3-trihydroxybiphenyl 2,2',3-biphenyltriol 3-(2-hydroxyphenyl)catechol biphenyl-2,2',3-triol |
keggC:C03569 | 2,2',3-Trihydroxybiphenyl |
seedM:cpd02240 | 2,2',3-Trihydroxybiphenyl 2,2',3-biphenyltriol 2,2',3-trihydroxybiphenyl 3-(2-hydroxyphenyl)catechol biphenyl-2,2',3-triol |
chebi:28517 | biphenyl-2,2',3-triol 2,2',3-Trihydroxybiphenyl 2,2',3-biphenyltriol 3-(2-hydroxyphenyl)catechol [1,1'-biphenyl]-2,2',3-triol |
envipath:...ea3dbd4ab1e7 | compound 43859 |
chebi:19276 chebi:852 keggC:M_C03569 seedM:M_cpd02240 | secondary/obsolete/fantasy identifier |
MNXM723284 | is deprecated and replaced by this entry |
MNXM724322 | is deprecated and replaced by this entry |