Feedback

propanoate

Properties
MNX_IDMNXM356
formulaC3H5O2
charge-1
mass73.0706
referencechebi:17272
Image of MNXM356
InChIKeyXBDQKXXYIPTUBI-UHFFFAOYSA-M
InChIInChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/p-1
SMILESCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref59
Distinct compatimentalized reactions in models35

Similar chemical compounds in external resources
IdentifierDescription
biggM:ppa Propionate (n-C3:0)
keggC:C00163
sabiorkM:1955
Propanoate
Propanoic acid
Propionate
Propionic acid
lipidmaps:LMFA01010003 Propionic acid
C3:0
Ethanecarboxylic acid
Ethylformic acid
FA(3:0)
Methylacetic acid
Pseudoacetic acid
propanoic acid
propionate
envipath:...7796c66cf9d9 Propanoate
chebi:30768
reactome:R-ALL-429737
reactome:R-ALL-429754
propionic acid
CH3-CH2-COOH
PA
PROPANOIC ACID
Propanoic acid
Propionic acid
Propionsaeure
acide propanoique
acide propionique
carboxyethane
ethanecarboxylic acid
ethylformic acid
metacetonic acid
methylacetic acid
propanoic acid
propioic acid
propoic acid
pseudoacetic acid
biggM:M_ppa
chebi:14903
chebi:26290
chebi:26304
chebi:45227
chebi:8476
hmdb:HMDB00237
keggC:M_C00163
keggD:M_D02310
seedM:M_cpd00141
secondary/obsolete/fantasy identifier
seedM:cpd00141 Propionate
Propanoate
Propanoic acid
Propionate (n-C3:0)
Propionic acid
ethylformic acid
methylacetic acid
ppa
propanoate
propionate
propionic acid
keggD:D02310 Propionic acid (NF)
envipath:...a3f26551abdd compound 38031
hmdb:HMDB0000237 Propionic acid
Acide propanoique
Acide propionique
Adofeed
Antischim b
CH3-CH2-COOH
Carboxyethane
Chromium propionate
Ethanecarboxylate
Ethanecarboxylic acid
Ethylformate
Ethylformic acid
Lithium propanoate
Luprosil
Metacetonate
Metacetonic acid
Methylacetate
Methylacetic acid
MonoProp
PA
Potassium propionate
Propanate
Propanoate
Propanoic acid
Propcorn
Propioate
Propioic acid
Propionate
Propionic acid, zinc salt
Propionsaeure
Propkorn
Propoate
Propoic acid
Prozoin
Pseudoacetate
Pseudoacetic acid
Toxi-check
Zinc propionate
propanoic acid
chebi:17272 propanoate
CH3-CH2-COO(-)
EtCO2 anion
carboxylatoethane
ethanecarboxylate
ethylformate
metacetonate
methylacetate
propanate
propanoic acid, ion(1-)
propionate
pseudoacetate
slm:000001194 propionate
envipath:...93172a99dd2e compound 150
metacycM:PROPIONATE propanoate
ethylformic acid
methylacetic acid
propionate
propionic acid
MNXM162260is deprecated and replaced by this entry
MNXM723830is deprecated and replaced by this entry
MNXM724019is deprecated and replaced by this entry