Feedback

propanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM356Image of MNXM356
#reac
in my sandbox 0
in MNXref (generic)64
in models (compartimentalized) 37
formulaC3H5O2
charge-1
mass73.0706
referencechebi:17272
InChIKeyXBDQKXXYIPTUBI-UHFFFAOYSA-M
InChIInChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5)/p-1
SMILESCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17272
chebi:17272
propanoate
CH3-CH2-COO(-)
EtCO2 anion
carboxylatoethane
ethanecarboxylate
ethylformate
metacetonate
methylacetate
propanate
propanoic acid, ion(1-)
propionate
pseudoacetate
envipath:...7796c66cf9d9
envipathM:...7796c66cf9d9
Propanoate
sabiork.compound:1955
sabiorkM:1955
kegg.compound:C00163
keggC:C00163
Propanoate
Propanoic acid
Propionate
Propionic acid
bigg.metabolite:ppa
biggM:ppa
Propionate (n-C3:0)
seed.compound:cpd00141
seedM:cpd00141
Propionate
Propanoate
Propanoic acid
Propionate (n-C3:0)
Propionic acid
ethylformic acid
methylacetic acid
ppa
propanoate
propionate
propionic acid
kegg.drug:D02310
keggD:D02310
Propionic acid (NF)
hmdb:HMDB0000237 Propionic acid
Acide propanoique
Acide propionique
Adofeed
Antischim b
CH3-CH2-COOH
Carboxyethane
Chromium propionate
Ethanecarboxylate
Ethanecarboxylic acid
Ethylformate
Ethylformic acid
Lithium propanoate
Luprosil
Metacetonate
Metacetonic acid
Methylacetate
Methylacetic acid
MonoProp
PA
Potassium propionate
Propanate
Propanoate
Propanoic acid
Propcorn
Propioate
Propioic acid
Propionate
Propionic acid, zinc salt
Propionsaeure
Propkorn
Propoate
Propoic acid
Prozoin
Pseudoacetate
Pseudoacetic acid
Toxi-check
Zinc propionate
propanoic acid
lipidmaps:LMFA01010003
lipidmapsM:LMFA01010003
Propionic acid
C3:0
Ethanecarboxylic acid
Ethylformic acid
FA(3:0)
Methylacetic acid
Pseudoacetic acid
propanoic acid
propionate
envipath:...93172a99dd2e
envipathM:...93172a99dd2e
compound 150
envipath:...a3f26551abdd
envipathM:...a3f26551abdd
compound 38031
metacyc.compound:PROPIONATE
metacycM:PROPIONATE
propanoate
ethylformic acid
methylacetic acid
propionate
propionic acid
SLM:000001194
slm:000001194
propionate
reactome:R-ALL-429737
reactomeM:R-ALL-429737
reactome:R-ALL-429754
reactomeM:R-ALL-429754
CHEBI:30768
chebi:30768
propionic acid
CH3-CH2-COOH
PA
PROPANOIC ACID
Propanoic acid
Propionic acid
Propionsaeure
acide propanoique
acide propionique
carboxyethane
ethanecarboxylic acid
ethylformic acid
metacetonic acid
methylacetic acid
propanoic acid
propioic acid
propoic acid
pseudoacetic acid
hmdb:HMDB00237
chebi:14903
chebi:26290
chebi:26304
chebi:45227
chebi:8476
biggM:M_ppa
keggC:M_C00163
keggD:M_D02310
seedM:M_cpd00141
secondary/obsolete/fantasy identifier