Feedback

trimetaphosphate

PropertiesImageOccurences in reactions
MNX_IDMNXM3570Image of MNXM3570
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 2
formulaO9P3
charge-3
mass236.915883
referencechebi:57801
InChIKeyAZSFNUJOCKMOGB-UHFFFAOYSA-K
InChIInChI=1S/H3O9P3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h(H,1,2)(H,3,4)(H,5,6)/p-3
SMILES[O-]P1(=O)OP([O-])(=O)OP([O-])(=O)O1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57801
chebi:57801
trimetaphosphate
1,3,5,2,4,6-trioxatriphosphinane-2,4,6-triolate 2,4,6-trioxide
cyclotriphosphate trianion
cyclotriphosphate(3-)
seed.compound:cpd01622
seedM:cpd01622
Trimetaphosphate
1,3,5,2,4,6-trioxatriphosphinane-2,4,6-triol 2,4,6-trioxide
1,3,5,2,4,6-trioxatriphosphinane-2,4,6-triolate 2,4,6-trioxide
2,4,6-trihydroxido-2,4,6-trioxido-1,3,5-trioxy-2,4,6-triphosphy-[6]cycle
Trimetaphosphoric acid
cyclo-Triphosphoric acid
cyclo-triphosphoric acid
tmp
tri--oxido-tris(hydroxidooxidophosphorus)
trimetaphosphate
trimetaphosphoric acid
hmdb:HMDB0059921 Trimetaphosphoric acid
1,3,5,2,4,6-Trioxatriphosphinane-2,4,6-triol 2,4,6-trioxide
H3P3O9
Trimetaphosphate
cyclo-Triphosphate
cyclo-Triphosphoric acid
trihydroxy-1,3,5,2lambda⁵,4lambda⁵,6lambda⁵-trioxatriphosphinane-2,4,6-trione
trimetaphosphoric acid
kegg.compound:C02466
keggC:C02466
Trimetaphosphoric acid
Trimetaphosphate
cyclo-Triphosphoric acid
CHEBI:16517
chebi:16517
cyclotriphosphoric acid
1,3,5,2,4,6-trioxatriphosphinane-2,4,6-triol 2,4,6-trioxide
2,4,6-trihydroxido-2,4,6-trioxido-1,3,5-trioxy-2,4,6-triphosphy-[6]cycle
H3P3O9
Trimetaphosphate
cyclo-Triphosphoric acid
cyclo-triphosphoric acid
tri-mu-oxido-tris(hydroxidooxidophosphorus)
trimetaphosphoric acid
metacyc.compound:CPD-610
metacycM:CPD-610
trimetaphosphate
1,3,5,2,4,6-trioxatriphosphinane-2,4,6-triol 2,4,6-trioxide
1,3,5,2,4,6-trioxatriphosphinane-2,4,6-triolate 2,4,6-trioxide
2,4,6-trihydroxido-2,4,6-trioxido-1,3,5-trioxy-2,4,6-triphosphy-[6]cycle
TMP
cyclo-triphosphoric acid
tri--oxido-tris(hydroxidooxidophosphorus)
trimetaphosphoric acid
hmdb:HMDB59921
chebi:15260
chebi:29204
chebi:9726
keggC:M_C02466
seedM:M_cpd01622
secondary/obsolete/fantasy identifier