Feedback

dihydromonacolin L

PropertiesImageOccurences in reactions
MNX_IDMNXM3587Image of MNXM3587
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC19H30O3
charge0
mass306.4397
referencechebi:14158
InChIKeyAGNDLYBQPUJADV-VCWNUMGPSA-N
InChIInChI=1S/C19H30O3/c1-12-3-7-18-14(9-12)5-4-13(2)17(18)8-6-16-10-15(20)11-19(21)22-16/h4-5,12-18,20H,3,6-11H2,1-2H3/t12-,13+,14+,15-,16-,17+,18+/m1/s1
SMILESC[C@@H]1CC[C@@H]2[C@@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H](C)C=C[C@H]2C1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:14158
chebi:14158
dihydromonacolin L
(4R,6R)-6-{2-[(1S,2S,4aR,6R,8aS)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]ethyl}-4-hydroxyoxan-2-one
(4R,6R)-6-{2-[(1S,2S,4aR,6R,8aS)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]ethyl}-4-hydroxytetrahydro-2H-pyran-2-one
dihydromonacolin L lactone
kegg.compound:C15536
keggC:C15536
Dihydromonacolin L
seed.compound:cpd11211
seedM:cpd11211
Dihydromonacolin L
dihydromonacolin L lactone
dihydromonacolin-L
metacyc.compound:DIHYDROMONACOLIN-L
metacycM:DIHYDROMONACOLIN-L
dihydromonacolin L lactone
keggC:M_C15536
seedM:M_cpd11211
secondary/obsolete/fantasy identifier