Feedback

dTDP-beta-L-rhodinose

PropertiesImageOccurences in reactions
MNX_IDMNXM3590Image of MNXM3590
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 0
formulaC16H24N2O13P2
charge-2
mass514.314962
referencechebi:32341
InChIKeyANSAJFYVUGUZQP-QEHJDLSMSA-L
InChIInChI=1S/C16H26N2O13P2/c1-8-6-18(16(22)17-15(8)21)13-5-11(20)12(29-13)7-27-32(23,24)31-33(25,26)30-14-4-3-10(19)9(2)28-14/h6,9-14,19-20H,3-5,7H2,1-2H3,(H,23,24)(H,25,26)(H,17,21,22)/p-2/t9-,10-,11-,12+,13+,14+/m0/s1
SMILESC[C@@H]1O[C@@H](CC[C@@H]1O)OP([O-])(=O)OP([O-])(=O)OC[C@H]1O[C@H](C[C@@H]1O)n1cc(C)c(=O)[nH]c1=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:32341
chebi:32341
kegg.compound:C12447
keggC:C12447
dTDP-beta-L-rhodinose
metacyc.compound:CPD-15766
metacycM:CPD-15766
dTDP-L-rhodinose
seed.compound:cpd09198
seedM:cpd09198
dTDP-beta-L-rhodinose
dTDP-L-rhodinose
keggC:M_C12447
seedM:M_cpd09198
secondary/obsolete/fantasy identifier