Feedback

juvenile hormone III carboxylate

Properties
MNX_IDMNXM3627
formulaC15H23O3
charge-1
mass251.34132
referencechebi:83274
Image of MNXM3627
InChIKeyDIAZNFMKLJLDNM-AQAKBEBOSA-M
InChIInChI=1S/C15H24O3/c1-11(8-9-13-15(3,4)18-13)6-5-7-12(2)10-14(16)17/h6,10,13H,5,7-9H2,1-4H3,(H,16,17)/p-1/b11-6+,12-10+/t13-/m1/s1
SMILESC\C(CC[C@H]1OC1(C)C)=C/CC\C(C)=C\C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
keggC:M_C16504
seedM:M_cpd16292
secondary/obsolete/fantasy identifier
metacycM:CPD-12750 juvenile hormone III acid
(2E,6E,10R)-10,11-epoxy-3,7,11-trimethyl-2,6-dodecadienoate
juvenile hormone III carboxylate
chebi:83274 juvenile hormone III carboxylate
(2E,6E)-9-[(2R)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoate
chebi:80536 juvenile hormone III acid
(2E,6E)-(R)-10,11-epoxy-3,7,11-trimethyldodeca-2,6-dienoic acid
(2E,6E)-9-[(2R)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoic acid
keggC:C16504 Juvenile hormone III acid
(2E,6E,10R)-10,11-Epoxy-3,7,11-trimethyldodeca-2,6-dienoate
Juvenile-hormone-III carboxylate
seedM:cpd16292 Juvenile hormone III acid
(2E,6E,10R)-10,11-epoxy-3,7,11-trimethyl-2,6-dodecadienoate
JH acid
juvenile hormone III acid
juvenile hormone III carboxylate