Feedback

alpha-L-iduronic acid

PropertiesImageOccurences in reactions
MNX_IDMNXM3634Image of MNXM3634
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 0
formulaC6H9O7
charge-1
mass193.13146
referencechebi:43394
InChIKeyAEMOLEFTQBMNLQ-VCSGLWQLSA-M
InChIInChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/p-1/t1-,2-,3+,4+,6+/m0/s1
SMILESO[C@@H]1O[C@H]([C@@H](O)[C@H](O)[C@H]1O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:43394
chebi:43394
alpha-L-iduronic acid
L-IDURONIC ACID
alpha-L-idopyranuronic acid
seed.compound:cpd23457
seedM:cpd23457
IdoA
Iduronic_acid
alpha-L-idopyranuronate
alpha-L-iduronate
sabiork.compound:22819
sabiorkM:22819
alpha-L-Iduronic acid
metacyc.compound:CPD-12515
metacycM:CPD-12515
alpha-L-idopyranuronate
IdoA
seedM:M_cpd23457 secondary/obsolete/fantasy identifier