Feedback

(E)-p-coumaroylagmatine(1+)

PropertiesImageOccurences in reactions
MNX_IDMNXM3665Image of MNXM3665
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC14H21N4O2
charge1
mass277.3423
referencechebi:86078
InChIKeyAKIHYQWCLCDMMI-VMPITWQZSA-O
InChIInChI=1S/C14H20N4O2/c15-14(16)18-10-2-1-9-17-13(20)8-5-11-3-6-12(19)7-4-11/h3-8,19H,1-2,9-10H2,(H,17,20)(H4,15,16,18)/p+1/b8-5+
SMILESNC(=[NH2+])NCCCCNC(=O)\C=C\c1ccc(O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:86078
chebi:86078
(E)-p-coumaroylagmatine(1+)
(E)-N-(4-guanidinobutyl)-4-hydroxycinnamamide(1+)
(E)-coumaroylagmatine(1+)
[(4-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino}butyl)amino](imino)methanaminium
trans-coumaroylagmatine(1+)
trans-p-coumaroylagmatine(1+)
CHEBI:86080
chebi:86080
(E)-p-coumaroylagmatine
(2E)-N-[4-(carbamimidamido)butyl]-3-(4-hydroxyphenyl)prop-2-enamide
(E)-N-(4-guanidinobutyl)-4-hydroxycinnamamide
(E)-coumaroylagmatine
1-(trans-4'-hydroxycinnamoylamino)-4-guanidinobutane
trans-coumaroylagmatine
trans-p-coumaroylagmatine
hmdb:HMDB0033460 4-Hydroxycinnamoylagmatine
(2E)-N-(4-carbamimidamidobutyl)-3-(4-hydroxyphenyl)prop-2-enamide
(e)-Coumaroylagmatine
(e)-N-(4-Guanidinobutyl)-4-hydroxycinnamamide
1-(trans-4'-hydroxycinnamoylamino)-4-Guanidinobutane
N1-trans-P-Coumaroylagmatine
cis-P-Coumaroylagmatine
trans-Coumaroylagmatine
trans-P-Coumaroylagmatine
metacyc.compound:N-4-GUANIDINOBUTYL-4-HYDROXYCINNAMAMID
metacycM:N-4-GUANIDINOBUTYL-4-HYDROXYCINNAMAMID
4-coumaroylagmatine
N-(4-guanidinobutyl)-3-(4-hydroxyphenyl)-acrylamide
N-(4-guanidinobutyl)-4-hydroxycinnamide
seed.compound:cpd02741
seedM:cpd02741
N-(4-Guanidinobutyl)-4-hydroxycinnamide
4-coumaroylagmatine
N-(4-Guanidinobutyl)-4-hydroxycinnamamide
N-(4-guanidinobutyl)-3-(4-hydroxyphenyl)-acrylamide
N-(4-guanidinobutyl)-4-hydroxycinnamide
p-Coumaroylagmatine
sabiork.compound:7354
sabiorkM:7354
N-(4-Guanidinobutyl)-4-hydroxycinnamide
p-Coumaroylagmatine
CHEBI:58644
chebi:58644
N-(4-guanidinobutyl)-4-hydroxycinnamamide
amino[(4-{[3-(4-hydroxyphenyl)acryloyl]amino}butyl)amino]methaniminium
p-coumaroylagmatine(1+)
kegg.compound:C04498
keggC:C04498
p-Coumaroylagmatine
N-(4-Guanidinobutyl)-4-hydroxycinnamamide
N-(4-Guanidinobutyl)-4-hydroxycinnamide
CHEBI:32818
chebi:32818
p-coumaroylagmatine
N-(4-Guanidinobutyl)-4-hydroxycinnamamide
N-(4-Guanidinobutyl)-4-hydroxycinnamide
N-(4-guanidinobutyl)-4-hydroxycinnamamide
N-(4-guanidinobutyl)-p-hydroxycinnamamide
N-[4-(carbamimidamido)butyl]-3-(4-hydroxyphenyl)prop-2-enamide
coumaroylagmatine
hmdb:HMDB33460
chebi:12430
chebi:21469
chebi:21470
chebi:7089
keggC:M_C04498
seedM:M_cpd02741
secondary/obsolete/fantasy identifier