Feedback

neral

PropertiesImageOccurences in reactions
MNX_IDMNXM3672Image of MNXM3672
#reac
in my sandbox 0
in MNXref (generic)16
in models (compartimentalized) 0
formulaC10H16O
charge0
mass152.23344
referencechebi:29020
InChIKeyWTEVQBCEXWBHNA-YFHOEESVSA-N
InChIInChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7-
SMILESCC(C)=CCC\C(C)=C/C=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:29020
chebi:29020
neral
(2Z)-3,7-dimethylocta-2,6-dienal
Lemonal
Neral
cis-Citral
cis-citral
citral B
lipidmaps:LMPR0102010006
lipidmapsM:LMPR0102010006
Neral
seed.compound:cpd06738
seedM:cpd06738
Neral
cis-Citral
cis-citral
neral
neroli aldehyde
sabiork.compound:11933
sabiorkM:11933
kegg.compound:C09847
keggC:C09847
cis-Citral
Neral
metacyc.compound:CPD-9762
metacycM:CPD-9762
neral
cis-citral
neroli aldehyde
chebi:10483
chebi:25502
keggC:M_C09847
seedM:M_cpd06738
secondary/obsolete/fantasy identifier