Feedback

pelargonidin 3-O-rutinoside

PropertiesImageOccurences in reactions
MNX_IDMNXM3686Image of MNXM3686
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC27H30O14
charge0
mass578.5187
referencechebi:60048
InChIKeyIFYOHQQBIKDHFT-ASZXTAQUSA-N
InChIInChI=1S/C27H30O14/c1-10-19(31)21(33)23(35)26(38-10)37-9-18-20(32)22(34)24(36)27(41-18)40-17-8-14-15(30)6-13(29)7-16(14)39-25(17)11-2-4-12(28)5-3-11/h2-8,10,18-24,26-27,31-36H,9H2,1H3,(H2-,28,29,30)/t10-,18+,19-,20+,21+,22-,23+,24+,26+,27+/m0/s1
SMILESC[C@@H]1O[C@@H](OC[C@H]2O[C@@H](Oc3cc4c([O-])cc(O)cc4[o+]c3-c3ccc(O)cc3)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:60048
chebi:60048
pelargonidin 3-O-rutinoside
3-{[6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl]oxy}-7-hydroxy-2-(4-hydroxyphenyl)chromenium-5-olate
3-{[6-O-(alpha-L-rhamnopyranosyl)-beta-D-glucopyranosyl]oxy}-7-hydroxy-2-(4-hydroxyphenyl)chromenium-5-olate
pelargonidin 3-O-rutinoside betaine
kegg.compound:C12644
keggC:C12644
Pelargonidin 3-O-rutinoside
seed.compound:cpd09275
seedM:cpd09275
Pelargonidin 3-O-rutinoside
pelargonidin-3-O-rhamnoglucoside
pelargonidin-3-O-rutinoside
CHEBI:31968
chebi:31968
pelargonidin 3-O-rutinoside
5,7-dihydroxy-2-(4-hydroxyphenyl)chromenium-3-yl 6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside
Pelargonidin 3-O-rutinoside
metacyc.compound:CPD-7144
metacycM:CPD-7144
pelargonidin-3-O-rutinoside
pelargonidin-3-O-rhamnoglucoside
keggC:M_C12644
seedM:M_cpd09275
secondary/obsolete/fantasy identifier