Feedback

L-glutamine

PropertiesImageOccurences in reactions
MNX_IDMNXM37Image of MNXM37
#reac
in my sandbox 0
in MNXref (generic)353
in models (compartimentalized) 405
formulaC5H10N2O3
charge0
mass146.06914
referencechebi:58359
InChIKeyZDXPYRJPNDTMRX-VKHMYHEASA-N
InChIInChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1
SMILESNC(=O)CC[C@H]([NH3+])C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113522
reactomeM:R-ALL-113522
reactome:R-ALL-212615
reactomeM:R-ALL-212615
reactome:R-ALL-29472
reactomeM:R-ALL-29472
CHEBI:58359
chebi:58359
L-glutamine
(2S)-5-amino-2-ammonio-5-oxopentanoate
(2S)-5-amino-2-azaniumyl-5-oxopentanoate
L-glutamine zwitterion
kegg.drug:D00015
keggD:D00015
Glutamine (USP)
Endari (TN)
L-Glutamine (JP18)
Levoglutamide
Nutrestore (TN)
sabiork.compound:2011
sabiorkM:2011
kegg.compound:C00303
keggC:C00303
Glutamine
2-Aminoglutaramic acid
seed.compound:cpd00253
seedM:cpd00253
Glutamine
2-Aminoglutaramic acid
cll_204
bigg.metabolite:gln__L
biggM:gln__L
L-Glutamine
hmdb:HMDB0000641 L-Glutamine
(2S)-2,5-Diamino-5-oxopentanoate
(2S)-2,5-Diamino-5-oxopentanoic acid
(2S)-2-Amino-4-carbamoylbutanoate
(2S)-2-Amino-4-carbamoylbutanoic acid
(2S)-2-amino-4-carbamoylbutanoic acid
(S)-2,5-Diamino-5-oxopentanoate
(S)-2,5-Diamino-5-oxopentanoic acid
2-Aminoglutaramic acid
Cebrogen
D Glutamine
D-Glutamine
Endari
GLUTAMINE
Glavamin
Glumin
Glutamate 5-amide
Glutamate amide
Glutamic acid 5-amide
Glutamic acid amide
L Glutamine
L-(+)-Glutamine
L-2-Aminoglutaramate
L-2-Aminoglutaramic acid
L-2-Aminoglutaramidic acid
L-Glutamate g-amide
L-Glutamate gamma-amide
L-Glutamic acid 5-amide
L-Glutamic acid g-amide
L-Glutamic acid gamma-amide
L-Glutamid
L-Glutamide
L-Glutamin
L-Glutaminsaeure-5-amid
L-glutamine
Levoglutamid
Levoglutamida
Levoglutamide
Levoglutamidum
Levoglutamina
Nutrestore
Polyglutamine
Q
Stimulina
gamma-Glutamine
seed.compound:cpd00053
seedM:cpd00053
L-Glutamine
2-aminoglutaramic acid
L-2-Aminoglutaramic acid
L-gln
L-glutamine
gln
gln-L
glum
glumin
glutamic acid 5-amide
glutamine
proglumide
sabiork.compound:74
sabiorkM:74
L-Glutamine
Gln
L-2-Aminoglutaramic acid
kegg.compound:C00064
keggC:C00064
L-Glutamine
L-2-Aminoglutaramic acid
CHEBI:32665
chebi:32665
L-glutaminate
(2S)-2,5-diamino-5-oxopentanoate
L-glutamine anion
CHEBI:18050
chebi:18050
L-glutamine
(2S)-2,5-diamino-5-oxopentanoic acid
(2S)-2-amino-4-carbamoylbutanoic acid
(S)-2,5-diamino-5-oxopentanoic acid
GLUTAMINE
Glutamic acid 5-amide
Glutamic acid amide
L-(+)-glutamine
L-2-Aminoglutaramic acid
L-2-aminoglutaramic acid
L-Glutamin
L-Glutamine
L-Glutaminsaeure-5-amid
L-glutamic acid gamma-amide
Levoglutamide
Q
metacyc.compound:GLN
metacycM:GLN
L-glutamine
2-aminoglutaramic acid
L-gln
Q
gln
glum
glumin
glutamic acid 5-amide
glutamine
proglumide
CHEBI:32666
chebi:32666
L-glutaminium
(1S)-4-amino-1-carboxy-4-oxobutan-1-aminium
L-glutamine cation
CHEBI:32678
chebi:32678
glutaminate
2,5-diamino-5-oxopentanoate
gln(-)
glutamine anion
CHEBI:28300
chebi:28300
glutamine
2,5-diamino-5-oxopentanoic acid
2-Aminoglutaramic acid
2-amino-4-carbamoylbutanoic acid
Glutamin
Glutamine
Glutaminsaeure-5-amid
Hgln
glutamic acid gamma-amide
CHEBI:32679
chebi:32679
glutaminium
4-amino-1-carboxy-4-oxobutan-1-aminium
H2gln(+)
glutamine cation
biggM:gln-L
hmdb:HMDB00641
chebi:13110
chebi:21308
chebi:24316
chebi:42812
chebi:42814
chebi:42899
chebi:42943
chebi:5432
chebi:6227
biggM:M_gln__L
keggC:M_C00064
keggC:M_C00303
keggD:M_D00015
seedM:M_cpd00053
seedM:M_cpd00253
secondary/obsolete/fantasy identifier