Feedback

firefly D-luciferin

PropertiesImageOccurences in reactions
MNX_IDMNXM3700Image of MNXM3700
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC11H7N2O3S2
charge-1
mass279.31696
referencechebi:58038
InChIKeyBJGNCJDXODQBOB-SSDOTTSWSA-M
InChIInChI=1S/C11H8N2O3S2/c14-5-1-2-6-8(3-5)18-10(12-6)9-13-7(4-17-9)11(15)16/h1-3,7,14H,4H2,(H,15,16)/p-1/t7-/m1/s1
SMILESOc1ccc2nc(sc2c1)C1=N[C@H](CS1)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58038
chebi:58038
firefly D-luciferin
(4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate
Photinus luciferin anion
Photinus luciferin carboxylate
Photinus luciferin(1-)
metacyc.compound:PHOTINUS-LUCIFERIN
metacycM:PHOTINUS-LUCIFERIN
D-firefly luciferin
(4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate
(S)-2-(6'-hydroxy-2'-benzothiazolyl)-2-thiazoline-4-carboxylate
D-2-(4-hydroxybenzothiazol-2-yl)-2-thiazoline acid
D-photinus luciferin
seed.compound:cpd01776
seedM:cpd01776
Photinus luciferin
(4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate
(S)-2-(6'-hydroxy-2'-benzothiazolyl)-2-thiazoline-4-carboxylate
(S)-4,5-Dihydro-2-(6-hydroxy-1,3-benzothiazol-2-yl)thiazole-4- carboxylic acid
(S)-4,5-Dihydro-2-(6-hydroxy-1,3-benzothiazol-2-yl)thiazole-4-carboxylic acid
(S)-4,5-Dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylic acid
D-2-(4-hydroxybenzothiazol-2-yl)-2-thiazoline acid
D-firefly luciferin
D-photinus luciferin
Firefly luciferin
photinus luciferin
CHEBI:17165
chebi:17165
Photinus luciferin
(4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid
(S)-4,5-Dihydro-2-(6-hydroxy-1,3-benzothiazol-2-yl)thiazole-4-carboxylic acid
(S)-4,5-Dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylic acid
(S)-4,5-dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylic acid
(S)-4,5-dihydro-2-(6-hydroxybenzothiazol-2-yl)thiazole-4-carboxylic acid
Firefly luciferin
firefly luciferin
kegg.compound:C02740
keggC:C02740
Photinus luciferin
(S)-4,5-Dihydro-2-(6-hydroxy-1,3-benzothiazol-2-yl)thiazole-4-carboxylic acid
(S)-4,5-Dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylic acid
D-Firefly luciferin
Firefly luciferin
chebi:12731
chebi:22004
chebi:8172
keggC:M_C02740
seedM:M_cpd01776
secondary/obsolete/fantasy identifier