Feedback

Reduced 2,6-Dichlorophenolindophenol

PropertiesImageOccurences in reactions
MNX_IDMNXM3706Image of MNXM3706
#reac
in my sandbox 0
in MNXref (generic)29
in models (compartimentalized) 0
formulaC12H8Cl2NO2
charge-1
mass269.10286
referencekeggC:C05720
InChIKeyIFTGQCOAUCEONK-UHFFFAOYSA-M
InChIInChI=1S/C12H9Cl2NO2/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7/h1-6,15-17H/p-1
SMILESOc1ccc(Nc2cc(Cl)c([O-])c(Cl)c2)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
kegg.compound:C05720
keggC:C05720
Reduced 2,6-Dichlorophenolindophenol
2,6-Dichloro-4-[(4-hydroxyphenyl)amino]-phenol
seed.compound:cpd12757
seedM:cpd12757
Reduced 2,6-Dichlorophenolindophenol
2,6-Dichloro-4-[(4-hydroxyphenyl)amino]-phenol
2,6-dichloro-4-[(4-hydroxyphenyl)amino]phenol
DCPIP
reduced 2,6-dichlorophenolindophenol
reduced DCIP
reduced DCPIP
reduced dichloroindophenol
sabiork.compound:8091
sabiorkM:8091
Reduced 2,6-dichlorophenolindophenol
2,6-Dichloro-4-[(4-hydroxyphenyl)amino]phenol
metacyc.compound:CPD-13079
metacycM:CPD-13079
reduced DCPIP
2,6-dichloro-4-[(4-hydroxyphenyl)amino]phenol
reduced 2,6-dichlorophenolindophenol
reduced DCIP
reduced dichloroindophenol
keggC:M_C05720
seedM:M_cpd12757
secondary/obsolete/fantasy identifier