Feedback

(1R,2S)-epoxypropylphosphonate

PropertiesImageOccurences in reactions
MNX_IDMNXM3733Image of MNXM3733
#reac
in my sandbox 0
in MNXref (generic)7
in models (compartimentalized) 0
formulaC3H6O4P
charge-1
mass137.051101
referencechebi:62247
InChIKeyYMDXZJFXQJVXBF-STHAYSLISA-M
InChIInChI=1S/C3H7O4P/c1-2-3(7-2)8(4,5)6/h2-3H,1H3,(H2,4,5,6)/p-1/t2-,3+/m0/s1
SMILESC[C@@H]1O[C@@H]1P(O)([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:62247
chebi:62247
(1R,2S)-epoxypropylphosphonate
(1R,2S)-epoxypropylphosphonate(1-)
fosfomycin
fosfomycin(1-)
hydrogen [(2R,3S)-3-methyloxiran-2-yl]phosphonate
CHEBI:62419
chebi:62419
(1R,2S)-epoxypropylphosphonate(2-)
(1R,2S)-epoxypropylphosphonate
(1R,2S)-epoxypropylphosphonate dianion
[(2R,3S)-3-methyloxiran-2-yl]phosphonate
fosfomycin
fosfomycin dianion
fosfomycin(2-)
kegg.drug:D04253
keggD:D04253
Fosfomycin (USAN/INN)
FCM
Phosphonomycin
hmdb:HMDB0014966 Fosfomycin
(-)-(1R,2S)-(1,2-Epoxypropyl)phosphonate
(-)-(1R,2S)-(1,2-Epoxypropyl)phosphonic acid
(1R,2S)-Epoxypropylphosphonate
(1R,2S)-Epoxypropylphosphonic acid
(2R-cis)-(3-Methyloxiranyl)phosphonate
(2R-cis)-(3-Methyloxiranyl)phosphonic acid
1R-cis-(1,2-Epoxypropyl)phosphonate
1R-cis-(1,2-Epoxypropyl)phosphonic acid
FCM
Fosfocina
Fosfomicina
Fosfomycin disodium salt
Fosfomycin sodium
Fosfomycin trometamol salt
Fosfomycin tromethamine
Fosfomycine
Fosfomycinum
Fosfonomycin
L-cis-1,2-Epoxypropylphosphonate
L-cis-1,2-Epoxypropylphosphonic acid
Monuril
Phosphomycin
Phosphomycin disodium salt
Phosphonemycin
Phosphonomycin
Tromethamine, fosfomycin
[(2R,3S)-3-methyloxiran-2-yl]phosphonic acid
cis-(1R,2S)-Epoxypropylphosphonate
cis-(1R,2S)-Epoxypropylphosphonic acid
fosfomycin
seed.compound:cpd03872
seedM:cpd03872
Fosfomycin
(1R,2S)-Epoxypropylphosphonate
(1R,2S)-epoxypropylphosphonate
(1R,2S)-epoxypropylphosphonic acid
L-cis-1,2-epoxypropylphosphonic acid
Phosphonomycin
cis-(1R,2S)-epoxypropylphosphonic acid
fosfomycin
phosphomycin
phosphonemycin
phosphonomycin
kegg.compound:C06454
keggC:C06454
Fosfomycin
(1R,2S)-Epoxypropylphosphonate
Phosphonomycin
sabiork.compound:8644
sabiorkM:8644
Phosphonomycin
Fosfomycin
CHEBI:28915
chebi:28915
fosfomycin
(-)-(1R,2S)-(1,2-Epoxypropyl)phosphonic acid
(1R,2S)-epoxypropylphosphonic acid
(2R-cis)-(3-Methyloxiranyl)phosphonic acid
1R-cis-(1,2-epoxypropyl)phosphonic acid
FCM
FOSFOMYCIN
L-cis-1,2-epoxypropylphosphonic acid
Phosphomycin
Phosphonomycin
[(2R,3S)-3-methyloxiran-2-yl]phosphonic acid
cis-(1R,2S)-epoxypropylphosphonic acid
fosfomicina
fosfomycine
fosfomycinum
phosphonemycin
metacyc.compound:CPD0-1113
metacycM:CPD0-1113
fosfomycin
(1R,2S)-epoxypropylphosphonate
(1R,2S)-epoxypropylphosphonic acid
L-cis-1,2-epoxypropylphosphonic acid
cis-(1R,2S)-epoxypropylphosphonic acid
phosphonemycin
phosphonomycin
hmdb:HMDB14966
chebi:24100
chebi:42503
chebi:8159
keggC:M_C06454
keggD:M_D04253
seedM:M_cpd03872
secondary/obsolete/fantasy identifier