Feedback

(5S,6S)-6-amino-5-hydroxycyclohexa-1,3-diene-1-carboxyate

PropertiesImageOccurences in reactions
MNX_IDMNXM3745Image of MNXM3745
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC7H9NO3
charge0
mass155.1513
referencechebi:60849
InChIKeyXBTXTLKLSHACSS-WDSKDSINSA-N
InChIInChI=1S/C7H9NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,5-6,9H,8H2,(H,10,11)/t5-,6-/m0/s1
SMILES[NH3+][C@@H]1[C@@H](O)C=CC=C1C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:60849
chebi:60849
(5S,6S)-6-amino-5-hydroxycyclohexa-1,3-diene-1-carboxyate
(2S,3S)-2,3-dihydro-3-hydroxyanthranilic acid zwitterion
(2S,3S)-2-amino-2,3-dihydro-3-hydroxybenzoic acid zwitterion
(5S,6S)-6-amino-5-hydroxycyclohexa-1,3-diene-1-carboxylate
(5S,6S)-6-ammonio-5-hydroxycyclohexa-1,3-diene-1-carboxylate
CHEBI:60844
chebi:60844
(2S,3S)-2,3-dihydro-3-hydroxyanthranilic acid
(2S,3S)-2-amino-2,3-dihydro-3-hydroxybenzoic acid
(2S,3S)-TRANS-2,3-DIHYDRO-3-HYDROXYANTHRANILIC ACID
(5S,6S)-6-amino-5-hydroxycyclohexa-1,3-diene-1-carboxylic acid
kegg.compound:C19830
keggC:C19830
(5S,6S)-6-Amino-5-hydroxycyclohexa-1,3-diene-1-carboxylate
DHHA
trans-2,3-Dihydro-3-hydroxyanthranilate
trans-2,3-Dihydro-3-hydroxyanthranilic acid
metacyc.compound:CPD-9518
metacycM:CPD-9518
(5S,6S)-6-amino-5-hydroxycyclohexa-1,3-diene-1-carboxylate
trans-2,3-dihydro-3-hydroxyanthranilate
trans-2,3-dihydro-3-hydroxyanthranilic acid
seed.compound:cpd17077
seedM:cpd17077
trans-2,3-dihydro-3-hydroxyanthranilic acid
(5S,6S)-6-Amino-5-hydroxycyclohexane-1,3-diene-1-carboxyate
(5S,6S)-6-amino-5-hydroxycyclohexa-1,3-diene-1-carboxylate
DHHA
dhha
trans-2,3-Dihydro-3-hydroxyanthranilate
trans-2,3-Dihydro-3-hydroxyanthranilic acid
chebi:43073
keggC:M_C19830
seedM:M_cpd17077
secondary/obsolete/fantasy identifier