Feedback

(R)-2-hydroxyoctadecanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM3762Image of MNXM3762
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC18H35O3
charge-1
mass299.4687
referencechebi:57562
InChIKeyKIHBGTRZFAVZRV-QGZVFWFLSA-M
InChIInChI=1S/C18H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h17,19H,2-16H2,1H3,(H,20,21)/p-1/t17-/m1/s1
SMILESCCCCCCCCCCCCCCCC[C@@H](O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57562
chebi:57562
(R)-2-hydroxyoctadecanoate
(2R)-2-hydroxyoctadecanoate
(R)-2-hydroxystearate
kegg.compound:C03042
keggC:C03042
(R)-2-Hydroxystearate
seed.compound:cpd01945
seedM:cpd01945
(R)-2-Hydroxystearate
(R)-2-hydroxystearate
R-2-hydroxystearate
CHEBI:15913
chebi:15913
(R)-2-hydroxyoctadecanoic acid
(2R)-2-hydroxyoctadecanoic acid
(R)-2-hydroxystearic acid
metacyc.compound:R-2-HYDROXYSTEARATE
metacycM:R-2-HYDROXYSTEARATE
(R)-2-hydroxystearate
lipidmaps:LMFA02000195
lipidmapsM:LMFA02000195
2R-hydroxy-stearic acid
2R-hydroxy-octadecanoic acid
FA(18:0(OH))
chebi:10975
chebi:18653
chebi:312
keggC:M_C03042
seedM:M_cpd01945
secondary/obsolete/fantasy identifier