Feedback

1-chloro-2,2-bis(4'-chlorophenyl)ethylene

PropertiesImageOccurences in reactions
MNX_IDMNXM3781Image of MNXM3781
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC14H9Cl3
charge0
mass281.97698
referencechebi:27454
InChIKeyLNKQQZFLNUVWQQ-UHFFFAOYSA-N
InChIInChI=1S/C14H9Cl3/c15-9-14(10-1-5-12(16)6-2-10)11-3-7-13(17)8-4-11/h1-9H
SMILESClC=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:27454
chebi:27454
1-chloro-2,2-bis(4'-chlorophenyl)ethylene
1,1-Bis(p-chlorophenyl)-2-chloroethene
1,1-Bis(p-chlorophenyl)-2-chloroethylene
1,1-bis(4-chlorophenyl)-2-chloroethylene
1-Chloro-2,2-bis(4'-chlorophenyl)ethylene
1-Chloro-2,2-bis(p-chlorophenyl)ethylene
2,2-Bis(4-chlorophenyl)-1-chloroethylene
2,2-Bis(p-chlorophenyl)-1-chloroethylene
4,4'-DDMU
DDMU
kegg.compound:C06637
keggC:C06637
1-Chloro-2,2-bis(4'-chlorophenyl)ethylene
DDMU
envipath:...03f1fad65c68
envipathM:...03f1fad65c68
1-Chloro-2,2-bis(4`-chlorophenyl)ethylene (DDMU)
seed.compound:cpd04041
seedM:cpd04041
DDMU
1-Chloro-2,2-bis(4'-chlorophenyl)ethylene
chebi:19035
chebi:619
keggC:M_C06637
seedM:M_cpd04041
secondary/obsolete/fantasy identifier