Feedback

O-phospho-L-serine

PropertiesImageOccurences in reactions
MNX_IDMNXM379Image of MNXM379
#reac
in my sandbox 0
in MNXref (generic)30
in models (compartimentalized) 12
formulaC3H6NO6P
charge-2
mass183.056641
referencechebi:57524
InChIKeyBZQFBWGGLXLEPQ-REOHCLBHSA-L
InChIInChI=1S/C3H8NO6P/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/p-2/t2-/m0/s1
SMILES[NH3+][C@@H](COP([O-])([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57524
chebi:57524
O-phospho-L-serine
(2S)-2-ammonio-3-(phosphonatooxy)propanoate
(2S)-2-azaniumyl-3-(phosphonatooxy)propanoate
O-phosphonato-L-serine(2-)
hmdb:HMDB0001721 DL-O-Phosphoserine
2-amino-3-(Phosphonooxy)propanoate
2-amino-3-(Phosphonooxy)propanoic acid
2-amino-3-(phosphonooxy)propanoic acid
3-Phosphoserine
3-phospho-1-Serine
3-phospho-Serine
DL-O-Phosphorylserine
DL-O-Serine phosphate
DL-Serine dihydrogen phosphate
DL-Serine dihydrogen phosphoric acid
DL-Serine monophosphorate
DL-Serine monophosphoric acid
DL-Serine, dihydrogen phosphate (ester)
DL-Serine, dihydrogen phosphoric acid (ester)
Energoserina
O-Phosphonoserine
O-phospho-DL-Serine
O-phospho-L-Serine
P-Serine
P-serine
Phosphate, serine
Phosphate, seryl
Phosphorylserine
Phosphoserine
Serine phosphate
Serine-3-phosphate
Serophen
Seryl phosphate
metacyc.compound:Phosphoserines
metacycM:Phosphoserines
L(or D)-O-phosphoserine
bigg.metabolite:pser__L
biggM:pser__L
O-Phospho-L-serine
kegg.compound:C01005
keggC:C01005
O-Phospho-L-serine
3-Phospho-L-serine
3-Phosphoserine
Dexfosfoserine
L-O-Phosphoserine
sabiork.compound:2212
sabiorkM:2212
O-Phospho-L-serine
3-Phosphoserine
L-O-Phosphoserine
reactome:R-ALL-936706
reactomeM:R-ALL-936706
CHEBI:15811
chebi:15811
O-phospho-L-serine
(+)-L-serine dihydrogen phosphate (ester)
(2S)-2-amino-3-(phosphonooxy)propanoic acid
(S)-2-amino-3-hydroxypropanoic acid 3-phosphate
3-Phosphoserine
Dexfosfoserine
L-O-Phosphoserine
O-Phospho-L-serine
O-phosphono-L-serine
O-phosphoserine
dexfosfoserine
phosphoserine
metacyc.compound:3-P-SERINE
metacycM:3-P-SERINE
O-phospho-L-serine
3-phospho-L-serine
L-serine 3-phosphate
L-serine phosphate
L-serine-3P
L-seryl phosphate
phosphoryl-L-serine
CHEBI:67032
chebi:67032
O-phosphonatooxyserine(2-)
2-ammonio-3-(phosphonatooxy)propanoate
2-azaniumyl-3-(phosphonatooxy)propanoate
O-phosphonatooxyserine
CHEBI:37712
chebi:37712
O-phosphoserine
2-amino-3-(phosphonooxy)propanoic acid
DL-serine dihydrogen phosphate
DL-serine, dihydrogen phosphate (ester)
O-phosphonoserine
phosphoserine
seed.compound:cpd27874
seedM:cpd27874
Phosphoserines
hmdb:HMDB0000272 Phosphoserine
(+)-L-Serine dihydrogen phosphate (ester)
(+)-L-Serine dihydrogen phosphoric acid (ester)
(2S)-2-amino-3-(Phosphonooxy)propanoate
(2S)-2-amino-3-(Phosphonooxy)propanoic acid
(2S)-2-amino-3-(phosphonooxy)propanoic acid
(S)-2-amino-3-Hydroxypropanoate 3-phosphate
(S)-2-amino-3-Hydroxypropanoic acid 3-phosphate
(S)-2-amino-3-Hydroxypropanoic acid 3-phosphoric acid
3-O-Phosphoserine
3-Phosphoserine
Dexfosfoserine
Fosforina
L-3-Phosphoserine
L-O-Phosphoserine
L-O-Serine phosphate
L-Phosphoserine
L-Serine dihydrogen phosphate (ester)
L-Serine phosphate
L-Serinephosphorate
L-Serinephosphoric acid
L-Seryl phosphate
O-Phosphoserine
Plasmenylserine
phosphoserine
seed.compound:cpd00738
seedM:cpd00738
phosphoserine
3-P-serine
3-Phosphoserine
3-phospho-L-serine
3-phospho-serine
3-phosphoserine
Dexfosfoserine
L-O-Phosphoserine
L-serine 3-phosphate
L-serine phosphate
L-serine-3P
L-seryl phosphate
O-Phospho-L-serine
O-phospho-L-serine
P-ser
P-serine
phosphoryl-L-serine
phosphorylserine
pser-L
serine phosphate
serine-3-p
serine-3-phosphate
seryl phosphate
hmdb:HMDB00272
hmdb:HMDB01721
chebi:12718
chebi:13037
chebi:21966
chebi:26084
chebi:7692
biggM:M_pser__L
keggC:M_C01005
seedM:M_cpd00738
seedM:M_cpd27874
secondary/obsolete/fantasy identifier