Feedback

2-hydroxyadipate

PropertiesImageOccurences in reactions
MNX_IDMNXM3812Image of MNXM3812
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 5
formulaC6H8O5
charge-2
mass160.03827
referencechebi:57987
InChIKeyOTTXIFWBPRRYOG-UHFFFAOYSA-L
InChIInChI=1S/C6H10O5/c7-4(6(10)11)2-1-3-5(8)9/h4,7H,1-3H2,(H,8,9)(H,10,11)/p-2
SMILESO=C([O-])CCCC(O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57987
chebi:57987
2-hydroxyadipate
2-hydroxyadipate dianion
2-hydroxyadipate(2-)
2-hydroxyhexanedioate
2-hydroxyhexanedioate dianion
2-hydroxyhexanedioate(2-)
sabiork.compound:6161
sabiorkM:6161
2-Hydroxyadipate
kegg.compound:C02360
keggC:C02360
2-Hydroxyadipate
2-Hydroxyadipic acid
seed.compound:cpd01576
seedM:cpd01576
2-Hydroxyadipate
2-Hydroxyadipic acid
2-hydroxyadipate
bigg.metabolite:adpoh
biggM:adpoh
2-Hydroxyadipic Acid
hmdb:HMDB0000321 2-Hydroxyadipic acid
2,3,4-Trideoxyhexarate
2,3,4-Trideoxyhexaric acid
2-Hydroxy-adipate
2-Hydroxy-adipic acid
2-Hydroxy-hexanedioate
2-Hydroxy-hexanedioic acid
2-Hydroxyadipate
2-Hydroxyhexanedioate
2-Hydroxyhexanedioic acid
2-hydroxyhexanedioic acid
DL-2-Hydroxyadipate
DL-2-Hydroxyadipic acid
a-Hydroxyadipate
a-Hydroxyadipic acid
alpha-Hydroxyadipate
alpha-Hydroxyadipic acid
alpha-hydroxyadipic acid
lipidmaps:LMFA01170049
lipidmapsM:LMFA01170049
2-Hydroxyadipic acid
2-hydroxy-Hexanedioic acid
FA 6:1
O3
metacyc.compound:CPD-333
metacycM:CPD-333
2-hydroxyadipate
CHEBI:17023
chebi:17023
2-hydroxyadipic acid
2-Hydroxyadipate
2-Hydroxyadipic acid
2-Hydroxyhexanedioic acid
2-hydroxyhexanedioic acid
envipath:...5dbe1b09925b
envipathM:...5dbe1b09925b
compound 42279
hmdb:HMDB00321
chebi:1145
chebi:11590
chebi:19627
biggM:M_adpoh
keggC:M_C02360
seedM:M_cpd01576
secondary/obsolete/fantasy identifier