Feedback

(indol-3-yl)acetate

PropertiesImageOccurences in reactions
MNX_IDMNXM383Image of MNXM383
#reac
in my sandbox 0
in MNXref (generic)90
in models (compartimentalized) 18
formulaC10H8NO2
charge-1
mass174.17606
referencechebi:30854
InChIKeySEOVTRFCIGRIMH-UHFFFAOYSA-M
InChIInChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1
SMILES[O-]C(=O)Cc1c[nH]c2ccccc12
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30854
chebi:30854
(indol-3-yl)acetate
1H-indol-3-ylacetate
2-(indol-3-yl)ethanoate
indole-3-acetate
metacyc.compound:INDOLE_ACETATE_AUXIN
metacycM:INDOLE_ACETATE_AUXIN
(indol-3-yl)acetate
(1H-indol-3-yl)acetate
IAA
auxin
indole-3-acetate
indole-3-acetic acid
indoleacetate
indoleacetic acid
CHEBI:16411
chebi:16411
(indol-3-yl)acetic acid
(Indol-3-yl)acetate
1H-indol-3-ylacetic acid
2-(indol-3-yl)ethanoic acid
3-Indolylessigsaeure
IAA
IES
Indole-3-acetic acid
Indoleacetic acid
heteroauxin
indole-3-acetic acid
bigg.metabolite:ind3ac
biggM:ind3ac
Indole 3 acetate
kegg.compound:C00954
keggC:C00954
Indole-3-acetate
(1H-indol-3-yl)acetate
(Indol-3-yl)acetate
IAA
Indole-3-acetic acid
Indoleacetate
Indoleacetic acid
sabiork.compound:5333
sabiorkM:5333
Indole-3-acetate
Indole-3-acetic acid
Indoleacetate
Indoleacetic acid
seed.compound:cpd00703
seedM:cpd00703
Indoleacetate
(1H-indol-3-yl)acetate
(Indol-3-yl)acetate
(indol-3-yl)acetate
IAA
Indole-3-acetate
Indole-3-acetic acid
Indoleacetic acid
auxin
ind3ac
indole-3-acetate
indole-3-acetic acid
indoleacetate
indoleacetic acid
hmdb:HMDB0000197 Indoleacetic acid
(1H-indol-3-yl)-Acetate
(1H-indol-3-yl)-Acetic acid
(indol-3-yl)Acetate
(indol-3-yl)Acetic acid
1H-Indole-3-acetate
1H-Indole-3-acetic acid
1H-indol-3-Ylacetate
1H-indol-3-Ylacetic acid
2-(1H-indol-3-yl)Acetate
2-(1H-indol-3-yl)Acetic acid
2-(1H-indol-3-yl)acetic acid
2-(3-Indolyl)acetate
2-(3-Indolyl)acetic acid
2-(indol-3-yl)Ethanoate
2-(indol-3-yl)Ethanoic acid
3-(Carboxymethyl)indole
3-IAA
3-Indole-acetic acid
3-Indoleacetate
3-Indoleacetic acid
3-Indolylacetate
3-Indolylacetic acid
3-Indolylessigsaeure
Heteroauxin
IAA
IES
IES CPD
Indole acetic acid
Indole-3-acetate
Indole-3-acetic acid
Indoleacetate
Indoleacetic acid, alpha-(14)C-labeled
Indoleacetic acid, calcium salt
Indoleacetic acid, monopotassium salt
Indoleacetic acid, monosodium salt
Indolyl-3-acetate
Indolyl-3-acetic acid
Indolylacetate
Indolylacetic acid
Kyselina 3-indolyloctova
Rhizopin
Rhizopon a
Skatole carboxylate
Skatole carboxylic acid
alpha-indol-3-yl-Acetic acid
b-Indoleacetate
b-Indoleacetic acid
b-Indolylacetate
b-Indolylacetic acid
beta-Indole-3-acetic acid
beta-Indoleacetate
beta-Indoleacetic acid
beta-Indolylacetate
beta-Indolylacetic acid
beta-indole-3-acetic acid
indol-3-Ylacetate
indol-3-Ylacetic acid
hmdb:HMDB00197
chebi:14447
chebi:14452
chebi:24801
chebi:24802
chebi:5905
biggM:M_ind3ac
keggC:M_C00954
seedM:M_cpd00703
secondary/obsolete/fantasy identifier