Feedback

(indol-3-yl)acetate

PropertiesImageOccurences in reactions
MNX_IDMNXM383Image of MNXM383
#reac
in my sandbox 0
in MNXref (generic)73
in models (compartimentalized) 24
formulaC10H8NO2
charge-1
mass174.05605
referencechebi:30854
InChIKeySEOVTRFCIGRIMH-UHFFFAOYSA-M
InChIInChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1
SMILESO=C([O-])Cc1c[nH]c2ccccc12
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:30854
chebi:30854
(indol-3-yl)acetate
1H-indol-3-ylacetate
2-(indol-3-yl)ethanoate
indole-3-acetate
metacyc.compound:INDOLE_ACETATE_AUXIN
metacycM:INDOLE_ACETATE_AUXIN
(indol-3-yl)acetate
(1H-indol-3-yl)acetate
IAA
auxin
indole-3-acetate
indole-3-acetic acid
indoleacetate
indoleacetic acid
CHEBI:16411
chebi:16411
(indol-3-yl)acetic acid
(Indol-3-yl)acetate
1H-indol-3-ylacetic acid
2-(indol-3-yl)ethanoic acid
3-Indolylessigsaeure
IAA
IES
Indole-3-acetic acid
Indoleacetic acid
heteroauxin
indole-3-acetic acid
bigg.metabolite:ind3ac
biggM:ind3ac
Indole 3 acetate
kegg.compound:C00954
keggC:C00954
Indole-3-acetate
(1H-indol-3-yl)acetate
(Indol-3-yl)acetate
IAA
Indole-3-acetic acid
Indoleacetate
Indoleacetic acid
sabiork.compound:5333
sabiorkM:5333
Indole-3-acetate
Indole-3-acetic acid
Indoleacetate
Indoleacetic acid
seed.compound:cpd00703
seedM:cpd00703
Indoleacetate
(1H-indol-3-yl)acetate
(Indol-3-yl)acetate
(indol-3-yl)acetate
IAA
Indole-3-acetate
Indole-3-acetic acid
Indoleacetic acid
auxin
ind3ac
indole-3-acetate
indole-3-acetic acid
indoleacetate
indoleacetic acid
hmdb:HMDB0000197 Indoleacetic acid
(+)-Lactate
(+)-Lactic acid
(-)-Cystine
(-)-Inosine
(1H-indol-3-yl)-Acetate
(1H-indol-3-yl)-Acetic acid
(1H-indol-3-yl)Acetate
(1H-indol-3-yl)Acetic acid
(2S)-6-(Acetylamino)-2-aminohexanoate
(2S)-6-(Acetylamino)-2-aminohexanoic acid
(R,R)-3,3'-Dithiobis(2-aminopropanoate)
(R,R)-3,3'-Dithiobis(2-aminopropanoic acid)
(R-(R*,r*))-3,3'-dithiobis
(R-(R*,r*))-3,3'-dithiobis(2-aminopropanoate)
(R-(R*,r*))-3,3'-dithiobis(2-aminopropanoic acid)
(S)-(+)-2-Hydroxypropanoate
(S)-(+)-2-Hydroxypropanoic acid
(S)-(+)-Lactate
(S)-(+)-Lactic acid
(S)-2-Hydroxy-propanoate
(S)-2-Hydroxy-propanoic acid
(S)-2-Hydroxypropanoate
(S)-2-Hydroxypropanoic acid
(S)-2-Hydroxypropionate
(S)-2-Hydroxypropionic acid
(S)-Lactate
(S)-Lactic acid
(alpha)-Lactate
(alpha)-Lactic acid
(indol-3-yl)Acetate
(indol-3-yl)Acetic acid
1,9-Dihydro-9-b-D-ribofuranosyl-6H-purin-6-one
1,9-Dihydro-9-beta-D-ribofuranosyl-6H-purin-6-one
1,9-Dihydro-9-beta-delta-ribofuranosyl-6H-purin-6-one
1-Hydroxyethane 1-carboxylate
1-Hydroxyethane 1-carboxylic acid
1-Hydroxyethanecarboxylate
1-Hydroxyethanecarboxylic acid
1H-Indole-3-acetate
1H-Indole-3-acetic acid
1H-indol-3-Ylacetate
1H-indol-3-Ylacetic acid
2 Hydroxypropanoic acid
2 Hydroxypropionic acid
2-(1H-indol-3-yl)Acetate
2-(1H-indol-3-yl)Acetic acid
2-(1H-indol-3-yl)acetic acid
2-(3-Indolyl)acetate
2-(3-Indolyl)acetic acid
2-(indol-3-yl)Ethanoate
2-(indol-3-yl)Ethanoic acid
2-Amino-3-(2-amino-2-carboxy-ethyl)disulfanyl-propanoate
2-Amino-3-(2-amino-2-carboxy-ethyl)disulfanyl-propanoic acid
2-Amino-3-[(2-amino-2-carboxyethyl)dithio]propanoate
2-Amino-3-[(2-amino-2-carboxyethyl)dithio]propanoic acid
2-Hydroxypropanoate
2-Hydroxypropanoic acid
2-Hydroxypropionate
2-Hydroxypropionic acid
3,3'-Dithiobis
3,3'-Dithiobis-L-alanine
3,3'-Dithiobis[2-amino-[R-(r*,r*)]-propanoate
3,3'-Dithiobis[2-amino-[R-(r*,r*)]-propanoic acid
3,3'-Dithiodialanine
3-(Carboxymethyl)indole
3-IAA
3-Indole-acetic acid
3-Indoleacetate
3-Indoleacetic acid
3-Indolylacetate
3-Indolylacetic acid
3-Indolylessigsaeure
9-b-D-Ribofuranosyl-9H-purin-6-ol
9-b-D-Ribofuranosyl-hypoxanthine
9-b-D-Ribofuranosylhypoxanthine
9-beta-D-Ribofuranosyl-9H-purin-6-ol
9-beta-D-Ribofuranosyl-hypoxanthine
9-beta-D-Ribofuranosylhypoxanthine
9-beta-D-ribofuranosyl-9H-purin-6-ol
9-beta-D-ribofuranosylhypoxanthine
9-beta-delta-Ribofuranosyl-hypoxanthine
9-beta-delta-Ribofuranosylhypoxanthine
9beta-D-Ribofuranosylhypoxanthine
9beta-delta-Ribofuranosylhypoxanthine
Ammonium lactate
Atorel
Balanine
Beta Alanyl 3 methylhistidine
Beta-Alanyl-3-methylhistidine
Bis(b-amino-b-carboxyethyl) disulfide
Bis(b-amino-b-carboxyethyl) disulphide
Bis(b-amino-beta-carboxyethyl) disulfide
Bis(beta-amino-beta-carboxyethyl) disulfide
Bis(beta-amino-beta-carboxyethyl) disulphide
Copper cystinate
Cysteine disulfide
Cystin
Cystine
Cystine acid
D Lactic acid
D(+)-3,3'-Dithiobis(2-aminopropanoate
D(+)-3,3'-Dithiobis(2-aminopropanoic acid
D-Lactic acid
Dicysteine
Gelucystine
HXR
Heteroauxin
Hypoxanthine 9-beta-D-ribofuranoside
Hypoxanthine 9-beta-delta-ribofuranoside
Hypoxanthine D-riboside
Hypoxanthine nucleoside
Hypoxanthine ribonucleoside
Hypoxanthine riboside
Hypoxanthine-9 beta-D-ribofuranoside
Hypoxanthine-9 beta-delta-ribofuranoside
Hypoxanthine-9-D-ribofuranoside
Hypoxanthine-9-beta-D-ribofuranoside
Hypoxanthine-9-beta-delta-ribofuranoside
Hypoxanthine-9-delta-ribofuranoside
Hypoxanthine-ribose
Hypoxanthosine
IAA
IES
IES CPD
Indole acetic acid
Indole-3-acetate
Indole-3-acetic acid
Indole-3-carboxaldehyde
Indoleacetate
Indoleacetic acid, alpha-(14)C-labeled
Indoleacetic acid, calcium salt
Indoleacetic acid, monopotassium salt
Indoleacetic acid, monosodium salt
Indolyl-3-acetate
Indolyl-3-acetic acid
Indolylacetate
Indolylacetic acid
Ino
Inosie
Inosin
Inosina
Inosinum
Inotin
Iso-prinosine
Kyselina 3-indolyloctova
L Cystine
L Lactic acid
L-(+)- Lactic acid
L-(+)-Lactate
L-(+)-Lactic acid
L-(+)-a-Hydroxypropionate
L-(+)-a-Hydroxypropionic acid
L-(+)-alpha-Hydroxypropionate
L-(+)-alpha-Hydroxypropionic acid
L-(+)-alpha-hydroxypropionate
L-(+)-alpha-hydroxypropionic acid
L-(-)-Cystine
L-2-Hydroxypropanoate
L-2-Hydroxypropanoic acid
L-Anserine
L-Cysteine disulfide
L-Cystin
L-Dicysteine
L-Lactate
L-Milchsaeure
L-N-b-Alanyl-3-methyl-histidine
L-N-beta-Alanyl-3-methyl-histidine
L-a-Diamino-b-dithiolactate
L-a-Diamino-b-dithiolactic acid
L-alpha-Diamino-beta-dithiolactate
L-alpha-Diamino-beta-dithiolactic acid
L-alpha-diamino-beta-dithiolactate
L-alpha-diamino-beta-dithiolactic acid
L-e-N-Acetyllysine
L-epsilon-N-Acetyllysine
Lactate
Lactate, ammonium
Lactic acid
Milk acid
N(6)-ACETYLLYSINE
N(6)-Acetyllsine
N(Z)-Acetyl-L-lysine
N(Z)-Acetyllysine
N(epsilon)-Acetyl-L-lysine
N(zeta)-Acetyl-L-lysine
N(zeta)-Acetyllysine
N(zeta)-acetyl-L-lysine
N(zeta)-acetyllysine
N-Epsilon-Acetyllysine
N-b-Alanyl-3-methyl-L-histidine
N-beta-Alanyl-3-methyl-L-histidine
N-e-Acetyl-L-lysine
N-e-Acetyllysine
N-epsilon-Acetyl-L-lysine
N6-Acetyllysine
Ne-acetyl-L-lysine
Ne-acetyllysine
Omega-N-acetyl-L-lysine
Omega-acetyllsine
Ophidine
Oxiamin
Oxidized L-cysteine
Panholic-L
Pantholic-L
Rhizopin
Rhizopon a
Ribonosine
Sarcolactic acid
Selfer
Skatole carboxylate
Skatole carboxylic acid
Trophicardyl
W-N-Acetyl-L-lysine
[R-(R*,r*)]-3,3'-dithiobis
a-Hydroxypropanoate
a-Hydroxypropanoic acid
a-Hydroxypropionate
a-Hydroxypropionic acid
alpha-Hydroxypropanoate
alpha-Hydroxypropanoic acid
alpha-Hydroxypropionate
alpha-Hydroxypropionic acid
alpha-indol-3-yl-Acetic acid
b,B'-diamino-b,b'-dicarboxydiethyl disulfide
b,B'-dithiodialanine
b,Beta'-diamino-b,beta'-dicarboxydiethyl disulfide
b,Beta'-diamino-b,beta'-dicarboxydiethyl disulphide
b,Beta'-dithiodialanine
b-Alanyl-3-methyl-L-histidine
b-Alanyl-N(pai)-methyl-L-histidine
b-Indoleacetate
b-Indoleacetic acid
b-Indolylacetate
b-Indolylacetic acid
beta,Beta'-diamino-beta,beta'-dicarboxydiethyl disulfide
beta,Beta'-diamino-beta,beta'-dicarboxydiethyl disulphide
beta,Beta'-dithiobisalanine
beta,Beta'-dithiodialanine
beta,beta'-diamino-beta,beta'-dicarboxydiethyl disulfide
beta,beta'-diamino-beta,beta'-dicarboxydiethyl disulphide
beta,beta'-dithiodialanine
beta-Alanyl-3-methyl-L-histidine
beta-Alanyl-N(pai)-methyl-L-histidine
beta-D-Ribofuranoside hypoxanthine-9
beta-Indole-3-acetic acid
beta-Indoleacetate
beta-Indoleacetic acid
beta-Indolylacetate
beta-Indolylacetic acid
beta-Inosine
beta-alanyl-3-methyl-L-histidine
beta-alanyl-N(pai)-methyl-L-histidine
beta-delta-Ribofuranoside hypoxanthine-9
beta-indole-3-acetic acid
e-Acetyl-L-lysine
e-N-Acetyl-L-lysine
e-N-Acetyllysine
e921
epsilon-Acetyl-L-lysine
epsilon-N-Acetyl-L-lysine
epsilon-N-Acetyllysine
i
indol-3-Ylacetate
indol-3-Ylacetic acid
hmdb:HMDB00197
chebi:14447
chebi:14452
chebi:24801
chebi:24802
chebi:5905
biggM:M_ind3ac
keggC:M_C00954
seedM:M_cpd00703
secondary/obsolete/fantasy identifier