Feedback

4'-O-beta-D-glucosyl-cis-4-coumarate

PropertiesImageOccurences in reactions
MNX_IDMNXM3857Image of MNXM3857
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC15H17O8
charge-1
mass325.09289
referencechebi:47892
InChIKeyLJFYQZQUAULRDF-LSSWKVNRSA-M
InChIInChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/p-1/b6-3-/t10-,12-,13+,14-,15-/m1/s1
SMILESO=C([O-])/C=C\c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:47892
chebi:47892
4'-O-beta-D-glucosyl-cis-4-coumarate
(2Z)-3-[4-(beta-D-glucopyranosyloxy)phenyl]acrylate
(2Z)-3-[4-(beta-D-glucopyranosyloxy)phenyl]prop-2-enoate
4'-O-beta-D-glucosyl-cis-p-coumarate
kegg.compound:C06739
keggC:C06739
4'-O-beta-D-Glucosyl-cis-p-coumarate
seed.compound:cpd12896
seedM:cpd12896
4'-O-beta-D-Glucosyl-cis-p-coumarate
4'-O-beta-D-glucosyl-cis-p-coumarate
metacyc.compound:4-O-BETA-D-GLUCOSYL-CIS-P-COUMARATE
metacycM:4-O-BETA-D-GLUCOSYL-CIS-P-COUMARATE
4'-O-beta-D-glucosyl-cis-p-coumarate
CHEBI:16099
chebi:16099
4'-O-beta-D-glucosyl-cis-p-coumaric acid
(2Z)-3-[4-(beta-D-glucopyranosyloxy)phenyl]acrylic acid
(2Z)-3-[4-(beta-D-glucopyranosyloxy)phenyl]prop-2-enoic acid
chebi:11913
chebi:1735
chebi:20253
keggC:M_C06739
seedM:M_cpd12896
secondary/obsolete/fantasy identifier