This is version 4.2 of MetaNetX/MNXref
 Feedback

3-hydroxypyruvate

PropertiesImageOccurences in reactions
MNX_IDMNXM392Image of MNXM392
#reac
in my sandbox 0
in MNXref (generic)24
in models (compartimentalized) 17
formulaC3H3O4
charge-1
mass103.05352
referencechebi:17180
InChIKeyHHDDCCUIIUWNGJ-UHFFFAOYSA-M
InChIInChI=1S/C3H4O4/c4-1-2(5)3(6)7/h4H,1H2,(H,6,7)/p-1
SMILESOCC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17180
chebi:17180
3-hydroxypyruvate
3-hydroxy-2-oxopropanoate
sabiork.compound:1959
sabiorkM:1959
3-Hydroxypyruvate
3-Hydroxy-2-oxopropanoate
3-Hydroxypyruvic acid
Hydroxypyruvate
Hydroxypyruvic acid
CHEBI:30841
chebi:30841
3-hydroxypyruvic acid
3-HYDROXYPYRUVIC ACID
3-Hydroxypyruvic acid
3-hydroxy-2-oxopropanoic acid
Hydroxypyruvic acid
bigg.metabolite:hpyr
biggM:hpyr
Hydroxypyruvate
seed.compound:cpd00145
seedM:cpd00145
Hydroxypyruvate
3-Hydroxypyruvate
3-Hydroxypyruvic acid
3-hydroxypyruvate
Hydroxypyruvic acid
OH-pyr
OH-pyruvate
beta-hydroxypyruvate
hpyr
hydroxypyruvate
kegg.compound:C00168
keggC:C00168
Hydroxypyruvate
3-Hydroxypyruvate
3-Hydroxypyruvic acid
Hydroxypyruvic acid
hmdb:HMDB0001352 Hydroxypyruvic acid
3-Hydroxy-2-oxopropanoate
3-Hydroxy-2-oxopropanoic acid
3-Hydroxypyruvate
3-Hydroxypyruvic acid
3-hydroxy-2-oxopropanoic acid
Hydroxypyruvate
Hydroxypyruvic acid, lithium salt
OH-Pyr
OH-Pyruvate
beta-Hydroxypyruvate
hydroxypyruvic acid
envipath:...b17c4f9bd437
envipathM:...b17c4f9bd437
compound 37994
envipath:...8e2ca0503508
envipathM:...8e2ca0503508
compound 657
metacyc.compound:OH-PYR
metacycM:OH-PYR
hydroxypyruvate
3-hydroxypyruvate
OH-pyr
OH-pyruvate
beta-hydroxypyruvate
hmdb:HMDB01352
chebi:11837
chebi:14425
chebi:20082
chebi:20083
chebi:39999
chebi:5813
biggM:M_hpyr
keggC:M_C00168
seedM:M_cpd00145
secondary/obsolete/fantasy identifier