Feedback

dodecanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM402Image of MNXM402
#reac
in my sandbox 0
in MNXref (generic)104
in models (compartimentalized) 57
formulaC12H23O2
charge-1
mass199.30982
referencechebi:18262
InChIKeyPOULHZVOKOAJMA-UHFFFAOYSA-M
InChIInChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/p-1
SMILESCCCCCCCCCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:18262
chebi:18262
dodecanoate
1-undecanecarboxylate
C12 fatty acid anion
CH3-[CH2]10-COO(-)
dodecoate
dodecylate
duodecyclate
duodecylate
laurate
laurostearate
n-dodecanoate
undecane-1-carboxylate
vulvate
bigg.metabolite:ddca
biggM:ddca
Dodecanoate (n-C12:0)
sabiork.compound:2488
sabiorkM:2488
Dodecanoate
Dodecanoic acid
Dodecylcarboxylate
Laurate
Lauric acid
hmdb:HMDB0000638 Dodecanoic acid
1-Undecanecarboxylate
1-Undecanecarboxylic acid
ABL
Aliphat no. 4
C12 Fatty acid
C12:0
CH3-[CH2]10-COOH
Coconut oil fatty acids
DAO
Dodecanoate
Dodecoate
Dodecoic acid
Dodecylate
Dodecylcarboxylate
Dodecylcarboxylic acid
Dodecylic acid
Duodecyclate
Duodecyclic acid
Duodecylate
Duodecylic acid
Edenor C 1298-100
Emery 651
Hystrene 9512
Kortacid 1299
Laate
Laic acid
Laurate
Lauric acid
Lauric acid, ammonium salt
Lauric acid, barium and cadmium salt (4:1:1)
Lauric acid, calcium salt
Lauric acid, lithium salt
Lauric acid, magnesium salt
Lauric acid, nickel(2+) salt
Lauric acid, potassium salt
Lauric acid, sodium salt
Laurinsaeure
Laurostearate
Laurostearic acid
Lunac L 70
Lunac L 98
N-Dodecanoate
N-Dodecanoic acid
Nissan naa 122
Philacid 1200
Potassium laurate
Prifac 2920
Sodium dodecanoate
Sodium laurate
Undecane-1-carboxylate
Undecane-1-carboxylic acid
Univol u 314
Vulvate
Vulvic acid
dodecanoic acid
lauric acid
neo-Fat 12
neo-Fat 12-43
kegg.compound:C02679
keggC:C02679
Dodecanoic acid
Dodecanoate
Dodecylcarboxylate
Lauric acid
envipath:...e3bf334e46ea
envipathM:...e3bf334e46ea
Lauric acid
kegg.drug:D10714
keggD:D10714
Lauric acid (NF)
lipidmaps:LMFA01010012
lipidmapsM:LMFA01010012
Lauric acid
C12:0
Dodecanoate
Dodecylic acid
FA(12:0)
Laurostearic acid
dodecanoic acid
n-Dodecanoic acid
seed.compound:cpd01741
seedM:cpd01741
ddca
Dodecanoate
Dodecanoate (n-C12:0)
Dodecanoic acid
Dodecylcarboxylate
Lauric acid
dodecanoate
dodecanoate (C12:0)
dodecanoic acid
laurate
lauric acid
n-dodecanoic acid
tin II 2-ethylhexanoate
SLM:000000719
slm:000000719
dodecanoate
Laurate
reactome:R-ALL-33549
reactomeM:R-ALL-33549
reactome:R-ALL-449678
reactomeM:R-ALL-449678
reactome:R-ALL-879557
reactomeM:R-ALL-879557
CHEBI:30805
chebi:30805
dodecanoic acid
1-undecanecarboxylic acid
ABL
C12 fatty acid
C12:0
CH3-[CH2]10-COOH
Coconut oil fatty acids
DAO
Dodecanoic acid
Dodecylcarboxylate
Dodecylic acid
Duodecyclic acid
Duodecylic acid
LAURIC ACID
Lauric acid
Laurinsaeure
Laurostearic acid
N-dodecanoic acid
Undecane-1-carboxylic acid
Vulvic acid
dodecoic acid
lauric acid
n-dodecanoic acid
metacyc.compound:DODECANOATE
metacycM:DODECANOATE
laurate
dodecanoate
dodecanoic acid
lauric acid
n-dodecanoic acid
tin II 2-ethylhexanoate
hmdb:HMDB00638
chebi:14187
chebi:23863
chebi:23864
chebi:23865
chebi:41882
chebi:4680
biggM:M_ddca
keggC:M_C02679
keggD:M_D10714
seedM:M_cpd01741
secondary/obsolete/fantasy identifier