Feedback

4-methyl-2-oxopentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM404Image of MNXM404
#reac
in my sandbox 0
in MNXref (generic)47
in models (compartimentalized) 25
formulaC6H9O3
charge-1
mass129.13386
referencechebi:17865
InChIKeyBKAJNAXTPSGJCU-UHFFFAOYSA-M
InChIInChI=1S/C6H10O3/c1-4(2)3-5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9)/p-1
SMILESCC(C)CC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113598
reactomeM:R-ALL-113598
reactome:R-ALL-70701
reactomeM:R-ALL-70701
CHEBI:17865
chebi:17865
4-methyl-2-oxopentanoate
2-Oxoisocaproate
alpha-ketoisocaproate
bigg.metabolite:4mop
biggM:4mop
4-Methyl-2-oxopentanoate
sabiork.compound:1985
sabiorkM:1985
4-Methyl-2-oxopentanoate
2-Ketoisocaproate
2-Oxoisocaproate
alpha-Ketoisocaproate
alpha-Oxoisocaproate
kegg.compound:C00233
keggC:C00233
4-Methyl-2-oxopentanoate
2-Oxoisocaproate
metacyc.compound:2K-4CH3-PENTANOATE
metacycM:2K-4CH3-PENTANOATE
4-methyl-2-oxopentanoate
2-keto-4-methyl-pentanoate
2-ketoisocaproate
2-ketoisocaproic acid
2-oxo-4-methylpentanoate
2-oxoisocaproate
4-methyl-2-oxopentanoic acid
alpha-ketoisocaproate
alpha-oxoisocaproate
ketoleucine
CHEBI:48430
chebi:48430
4-methyl-2-oxopentanoic acid
2-OXO-4-METHYLPENTANOIC ACID
2-Oxoisocaproate
4-Methyl-2-oxopentanoate
4-methyl-2-oxovaleric acid
Ketoleucine
alpha-ketoisocaproic acid
seed.compound:cpd00200
seedM:cpd00200
4MOP
2-Oxoisocaproate
2-keto-4-methyl-pentanoate
2-ketoisocaproate
2-ketoisocaproic acid
2-oxo-4-methylpentanoate
2-oxoisocaproate
4-Methyl-2-oxopentanoate
4-methyl-2-oxopentanoate
4-methyl-2-oxopentanoic acid
4mop
alpha-ketoisocaproate
alpha-oxoisocaproate
ketoleucine
hmdb:HMDB0000695 Ketoleucine
2-Ketoisocaproate
2-Ketoisocaproic acid
2-Oxoisocaproate
2-Oxoisocaproic acid
2-Oxoleucine
2-keto-4-Methylvalerate
2-keto-4-Methylvaleric acid
2-oxo-4-METHYLPENTANOIC ACID
2-oxo-4-METHYLPENTANOate
2-oxo-4-Methylvalerate
2-oxo-4-Methylvaleric acid
4-Methyl-2-oxo-valerate
4-Methyl-2-oxo-valeric acid
4-Methyl-2-oxopentanoate
4-Methyl-2-oxopentanoic acid
4-Methyl-2-oxovalerate
4-Methyl-2-oxovaleric acid
4-methyl-2-oxopentanoic acid
Keto-leucine
Ketoisocaproate
Ketoisocaproic acid
Methyloxovalerate
Methyloxovaleric acid
Oxoisocaproate
Oxoisocaproic acid
a-Ketoisocaproate
a-Ketoisocaproic acid
a-Ketoisocapronate
a-Ketoisocapronic acid
a-Oxoisocaproate
a-Oxoisocaproic acid
alpha-Ketoisocaproate
alpha-Ketoisocaproic acid
alpha-Ketoisocapronate
alpha-Ketoisocapronic acid
alpha-Oxoisocaproate
alpha-Oxoisocaproic acid
alpha-keto-Isocaproate
alpha-keto-Isocaproic acid
alpha-ketoisocaproate
alpha-ketoisocaproic acid
ketoisocaproate
hmdb:HMDB0000762
hmdb:HMDB00695
hmdb:HMDB00762
chebi:12020
chebi:1891
chebi:20438
chebi:41619
biggM:M_4mop
keggC:M_C00233
seedM:M_cpd00200
secondary/obsolete/fantasy identifier