Feedback

5-aminolevulinate

PropertiesImageOccurences in reactions
MNX_IDMNXM405Image of MNXM405
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 14
formulaC5H9NO3
charge0
mass131.1299
referencechebi:356416
InChIKeyZGXJTSGNIOSYLO-UHFFFAOYSA-N
InChIInChI=1S/C5H9NO3/c6-3-4(7)1-2-5(8)9/h1-3,6H2,(H,8,9)
SMILES[NH3+]CC(=O)CCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-189466
reactomeM:R-ALL-189466
reactome:R-ALL-189489
reactomeM:R-ALL-189489
CHEBI:356416
chebi:356416
5-aminolevulinate
5-ammonio-4-oxopentanoate
5-ammonio-4-oxovalerate
5-ammoniolevulinate
5-azaniumyl-4-oxopentanoate
bigg.metabolite:5aop
biggM:5aop
5-Amino-4-oxopentanoate
kegg.compound:C00430
keggC:C00430
5-Aminolevulinate
5-Amino-4-oxopentanoate
5-Amino-4-oxovaleric acid
seed.compound:cpd00338
seedM:cpd00338
5-Aminolevulinate
5-Amino-4-oxopentanoate
5-Amino-4-oxovaleric acid
5-amino-4-oxo-pentanoate
5-amino-4-oxo-pentanoic acid
5-amino-4-oxopentanoate
5-amino-4-oxopentanoic acid
5-amino-levulinate
5-amino-levulinic acid
5-aminolevulinate
5-aminolevulinic acid
5aop
ALA
Pentanoic acid, 5-amino-4-oxo-
delta-aminolevulinate
delta-aminolevulinic acid
gamma-aminolevulinic acid
hmdb:HMDB0001149 5-Aminolevulinic acid
5 Aminolaevulinate
5 Aminolevulinate
5-ALA
5-Aminolaevulinate
5-Aminolaevulinic acid
5-Aminolevulinate
5-amino-4-Oxopentanoate
5-amino-4-Oxopentanoic acid
5-amino-4-Oxovalerate
5-amino-4-Oxovaleric acid
5-amino-4-oxo-Pentanoate
5-amino-4-oxo-Pentanoic acid
5-amino-4-oxopentanoic acid
5-amino-Levulinate
5-amino-Levulinic acid
Acid hydrochloride, aminolevulinic
Acid, Delta-aminolevulinic
Acid, aminolevulinic
Aladerm
Aminolevulinate
Aminolevulinic acid
Aminolevulinic acid hydrochloride
Bertek brand OF aminolevulinic acid hydrochloride
DALA
Delta Aminolevulinic acid
Hydrochloride, aminolevulinic acid
Kerastick
Levulan
amino-Levulinic acid
aminolevulinic acid
delta-ALA
delta-Aminolevulinate
delta-Aminolevulinic acid
delta-ala
delta-aminolevulinate
delta-aminolevulinic acid
lipidmaps:LMFA01100055
lipidmapsM:LMFA01100055
5-amino-levulinic acid
4-oxo-5-amino-pentanoic acid
metacyc.compound:5-AMINO-LEVULINATE
metacycM:5-AMINO-LEVULINATE
5-aminolevulinate
5-amino-4-oxo-pentanoate
5-amino-4-oxo-pentanoic acid
5-amino-4-oxopentanoate
5-amino-4-oxopentanoic acid
5-amino-levulinate
5-amino-levulinic acid
5-aminolevulinic acid
ALA
delta-aminolevulinate
delta-aminolevulinic acid
CHEBI:12109
chebi:12109
5-aminolevulinate
5-amino-4-oxopentanoate
CHEBI:17549
chebi:17549
5-aminolevulinic acid
5-ALA
5-Amino-4-oxopentanoate
5-Amino-4-oxovaleric acid
5-Aminolevulinate
5-amino-4-oxopentanoic acid
aminolevulinic acid
dALA
delta-ALA
delta-aminolevulinic acid
CHEBI:132970
chebi:132970
5-ammoniolevulinic acid
4-carboxy-2-oxobutan-1-aminium
5-aminolevulinic acid cation
5-aminolevulinic acid(1+)
kegg.drug:D07567
keggD:D07567
Aminolevulinic acid
hmdb:HMDB01149
chebi:2034
chebi:20547
biggM:M_5aop
keggC:M_C00430
keggD:M_D07567
seedM:M_cpd00338
secondary/obsolete/fantasy identifier