Feedback

2-deoxy-D-ribono-1,4-lactone

PropertiesImageOccurences in reactions
MNX_IDMNXM4286Image of MNXM4286
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC5H8O4
charge0
mass132.04226
referencechebi:17281
InChIKeyYIXDEYPPAGPYDP-IUYQGCFVSA-N
InChIInChI=1S/C5H8O4/c6-2-4-3(7)1-5(8)9-4/h3-4,6-7H,1-2H2/t3-,4+/m0/s1
SMILESO=C1C[C@H](O)[C@@H](CO)O1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17281
chebi:17281
2-deoxy-D-ribono-1,4-lactone
(4S,5R)-4-hydroxy-5-(hydroxymethyl)dihydrofuran-2(3H)-one
2,4,5-TP
2,4,5-Trihydroxypentanoic acid gamma-lactone
2-Deoxy-ribono-1,4-lactone
2-Deoxyribonolactone
2-deoxy-D-erythro-pentonic acid gamma-lactone
2-deoxy-D-erythro-pentono-1,4-lactone
Deoxyribonolactone
metacyc.compound:DEOXYRIBONOLACTONE
metacycM:DEOXYRIBONOLACTONE
2-deoxyribonolactone
deoxyribonolactone
kegg.compound:C02674
keggC:C02674
Deoxyribonolactone
2-Deoxyribonolactone
seed.compound:cpd01737
seedM:cpd01737
Deoxyribonolactone
2-Deoxyribonolactone
2-deoxyribonolactone
deoxyribonolactone
envipath:...f0a3bf1e974f
envipathM:...f0a3bf1e974f
compound 0287463
chebi:11571
chebi:14122
chebi:23834
chebi:4430
keggC:M_C02674
seedM:M_cpd01737
secondary/obsolete/fantasy identifier