Feedback

dAMP

PropertiesImageOccurences in reactions
MNX_IDMNXM432Image of MNXM432
#reac
in my sandbox 0
in MNXref (generic)42
in models (compartimentalized) 32
formulaC10H12N5O6P
charge-2
mass329.206141
referencechebi:58245
InChIKeyKHWCHTKSEGGWEX-RRKCRQDMSA-L
InChIInChI=1S/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/p-2/t5-,6+,7+/m0/s1
SMILESNc1ncnc2n(cnc12)[C@H]1C[C@H](O)[C@@H](COP([O-])([O-])=O)O1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58245
chebi:58245
dAMP
2'-deoxy-5'-O-phosphonatoadenosine
2'-deoxyadenosine 5'-monophosphate
2'-deoxyadenosine 5'-monophosphate(2-)
dAMP(2-)
reactome:R-ALL-109295
reactomeM:R-ALL-109295
reactome:R-ALL-109386
reactomeM:R-ALL-109386
reactome:R-ALL-109732
reactomeM:R-ALL-109732
CHEBI:17713
chebi:17713
2'-deoxyadenosine 5'-monophosphate
2'-DEOXYADENOSINE-5'-MONOPHOSPHATE
2'-Deoxyadenosine 5'-monophosphate
2'-Deoxyadenosine 5'-phosphate
2'-dAMP
2'-deoxy-5'-adenosine monophosphate
2'-deoxy-5'-adenylic acid
2'-deoxy-AMP
2'-deoxyadenosine 5'-(dihydrogen phosphate)
2'-deoxyadenosine monophosphate
2'-deoxyadenylic acid
Deoxyadenosine monophosphate
Deoxyadenylic acid
dAMP
deoxy-5'-adenylic acid
deoxy-AMP
deoxyadenosine 5'-monophosphate
deoxyadenosine 5'-phosphate
bigg.metabolite:damp
biggM:damp
DAMP
hmdb:HMDB0000905 Deoxyadenosine monophosphate
2'-DEOXYADENOSINE-5'-monophosphATE
2'-DEOXYADENOSINE-5'-monophosphoric acid
2'-Deoxy-5'-adenosine monophosphate
2'-Deoxy-5'-adenosine monophosphate, ammonium salt
2'-Deoxy-5'-adenosine monophosphate, disodium salt
2'-Deoxy-5'-adenosine monophosphoric acid
2'-Deoxy-5'-adenylate
2'-Deoxy-5'-adenylic acid
2'-Deoxy-AMP
2'-Deoxy-adenosine 5'-phosphorate
2'-Deoxy-adenosine 5'-phosphoric acid
2'-Deoxyadenosine 5'-(dihydrogen phosphate)
2'-Deoxyadenosine 5'-(dihydrogen phosphoric acid)
2'-Deoxyadenosine 5'-monophosphate
2'-Deoxyadenosine 5'-monophosphoric acid
2'-Deoxyadenosine 5'-phosphate
2'-Deoxyadenosine 5'-phosphoric acid
2'-Deoxyadenosine monophosphate
2'-Deoxyadenosine monophosphoric acid
2'-Deoxyadenosine-5'-phosphate
2'-Deoxyadenylate
2'-Deoxyadenylic acid
2'-dAMP
2'Deoxy-5'-AMP
DAMP
Deoxy-5'-adenylate
Deoxy-5'-adenylic acid
Deoxy-AMP
Deoxyadenosine 5'-monophosphate
Deoxyadenosine 5'-monophosphoric acid
Deoxyadenosine 5'-phosphate
Deoxyadenosine 5'-phosphoric acid
Deoxyadenosine monophosphoric acid
Deoxyadenosine-phosphate
Deoxyadenylate
Deoxyadenylic acid
PdA
dAMP
dAMP CPD
{[(2R,3S,5R)-5-(6-amino-9H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy}phosphonic acid
seed.compound:cpd00294
seedM:cpd00294
dAMP
2'-Deoxyadenosine 5'-monophosphate
2'-Deoxyadenosine 5'-phosphate
2'-dAMP
2'-deoxyadenosine 5''-monophosphate
2'-deoxyadenosine 5'-phosphate
2'-deoxyadenosine-5'-monophosphate
2'-deoxyadenosine-5'-phosphate
Deoxyadenosine monophosphate
Deoxyadenylic acid
damp
sabiork.compound:62
sabiorkM:62
kegg.compound:C00360
keggC:C00360
dAMP
2'-Deoxyadenosine 5'-monophosphate
2'-Deoxyadenosine 5'-phosphate
Deoxyadenosine monophosphate
Deoxyadenylic acid
metacyc.compound:DAMP
metacycM:DAMP
dAMP
2'-dAMP
2'-deoxyadenosine 5''-monophosphate
2'-deoxyadenosine 5'-phosphate
deoxyadenosine-phosphate
hmdb:HMDB00905
chebi:10490
chebi:14068
chebi:19236
chebi:40419
chebi:40499
chebi:40505
chebi:40544
chebi:40607
chebi:41815
chebi:41864
biggM:M_damp
keggC:M_C00360
seedM:M_cpd00294
secondary/obsolete/fantasy identifier