Feedback

3-methyloxindole

PropertiesImageOccurences in reactions
MNX_IDMNXM4341Image of MNXM4341
#reac
in my sandbox 0
in MNXref (generic)1
in models (compartimentalized) 0
formulaC9H9NO
charge0
mass147.06841
referencechebi:17397
InChIKeyBBZCPUCZKLTAJQ-UHFFFAOYSA-N
InChIInChI=1S/C9H9NO/c1-6-7-4-2-3-5-8(7)10-9(6)11/h2-6H,1H3,(H,10,11)
SMILESCC1C(=O)Nc2ccccc21
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17397
chebi:17397
3-methyloxindole
1,3-Dihydro-3-methyl-2H-indol-2-one
3-Methyloxindole
3-methyl-1,3-dihydro-2H-indol-2-one
3-methyl-1,3-dihydroindol-2-one
kegg.compound:C02366
keggC:C02366
3-Methyloxindole
1,3-Dihydro-3-methyl-2H-indol-2-one
seed.compound:cpd01580
seedM:cpd01580
3-Methyloxindole
1,3-Dihydro-3-methyl-2H-indol-2-one
3-methyl-1,3-dihydroindol-2-one
3-methyloxindole
metacyc.compound:3-METHYLOXINDOLE
metacycM:3-METHYLOXINDOLE
3-methyloxindole
3-methyl-1,3-dihydroindol-2-one
chebi:11861
chebi:1608
chebi:20137
keggC:M_C02366
seedM:M_cpd01580
secondary/obsolete/fantasy identifier