This is version 4.2 of MetaNetX/MNXref
 Feedback

3-methyl-2-oxovalerate

MNXM439 is deprecated and here replaced by MNXM1103447
!!! Alternative mappings exist !!!
PropertiesImageOccurences in reactions
MNX_IDMNXM1103447Image of MNXM1103447
#reac
in my sandbox 0
in MNXref (generic)24
in models (compartimentalized) 18
formulaC6H9O3
charge-1
mass129.13386
referencechebi:28654
InChIKeyJVQYSWDUAOAHFM-UHFFFAOYSA-M
InChIInChI=1S/C6H10O3/c1-3-4(2)5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9)/p-1
SMILESCCC(C)C(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113576
reactomeM:R-ALL-113576
reactome:R-ALL-70721
reactomeM:R-ALL-70721
CHEBI:28654
chebi:28654
3-methyl-2-oxovalerate
2-Oxo-3-methylpentanoate
2-Oxo-3-methylvalerate
2-keto-3-methylvalerate
3-Methyl-2-oxopentanoate
3-Methyl-2-oxovalerate
3-methyl-2-oxopentanoate
alpha-keto-beta-methylvalerate
alpha-oxo-beta-methylvalerate
bigg.metabolite:3mop
biggM:3mop
(S)-3-Methyl-2-oxopentanoate
sabiork.compound:6645
sabiorkM:6645
3-Methyl-2-oxopentanoate
2-Ketoisoleucine
2-Oxo-3-methylpentanoate
2-Oxo-3-methylvalerate
2-Oxoisoleucine
alpha-Keto-beta-methyl-valerate
seed.compound:cpd19026
seedM:cpd19026
kegg.compound:C03465
keggC:C03465
3-Methyl-2-oxopentanoate
2-Oxo-3-methylvalerate
hmdb:HMDB0000491 3-Methyl-2-oxovaleric acid
(3R)-3-Methyl-2-oxopentanoate
(3R)-3-Methyl-2-oxopentanoic acid
(R)-3-Methyl-2-oxopentanoate
(R)-3-Methyl-2-oxopentanoic acid
(S)-3-Methyl-2-oxopentanoate
(S)-3-Methyl-2-oxopentanoic acid
2-Oxoisoleucine
2-Oxokolavenate
2-Oxokolavenic acid
2-keto Methylvalerate
2-keto-3-Methylvalerate
2-keto-3-Methylvaleric acid
2-oxo-3-Methyl-N-valerate
2-oxo-3-Methyl-N-valeric acid
2-oxo-3-Methylpentanoate
2-oxo-3-Methylpentanoic acid
2-oxo-3-Methylvalerate
2-oxo-3-Methylvaleric acid
3-Ethyl-3-methylpyruvate
3-Ethyl-3-methylpyruvic acid
3-Methyl-2-oxo-pentanoate
3-Methyl-2-oxo-pentanoic acid
3-Methyl-2-oxo-valerate
3-Methyl-2-oxo-valeric acid
3-Methyl-2-oxopentanoate
3-Methyl-2-oxopentanoic acid
3-Methyl-2-oxovalerate
3-Methyl-2-oxovaleric
3-methyl-2-oxopentanoic acid
KMVA
Ketoisoleucine
a-keto-b-Methyl-N-valerate
a-keto-b-Methyl-N-valeric acid
a-keto-b-Methylvalerate
a-keto-b-Methylvaleric acid
a-oxo-b-Methyl-N-valerate
a-oxo-b-Methyl-N-valeric acid
a-oxo-b-Methylvalerate
a-oxo-b-Methylvaleric acid
alpha-keto-beta-Methyl-N-valerate
alpha-keto-beta-Methyl-N-valeric acid
alpha-keto-beta-Methylvalerate
alpha-keto-beta-Methylvaleric acid
alpha-keto-beta-Methylvaleric acid, (+-)-isomer
alpha-keto-beta-Methylvaleric acid, (S)-isomer
alpha-keto-beta-Methylvaleric acid, calcium salt
alpha-keto-beta-Methylvaleric acid, calcium salt, (S)-isomer
alpha-keto-beta-Methylvaleric acid, monosodium salt, (S)-isomer
alpha-keto-beta-Methylvaleric acid, sodium salt
alpha-keto-beta-Methylvaleric acid, sodium salt, (+-)-isomer
alpha-keto-beta-methyl-N-valerate
alpha-keto-beta-methyl-N-valeric acid
alpha-keto-beta-methylvalerate
alpha-keto-beta-methylvaleric acid
alpha-oxo-beta-Methyl-N-valerate
alpha-oxo-beta-Methyl-N-valeric acid
alpha-oxo-beta-Methylvalerate
alpha-oxo-beta-Methylvaleric acid
alpha-oxo-beta-methyl-N-valerate
alpha-oxo-beta-methyl-N-valeric acid
alpha-oxo-beta-methylvalerate
alpha-oxo-beta-methylvaleric acid
CHEBI:35932
chebi:35932
3-methyl-2-oxovaleric acid
2-Oxo-3-methyl-n-valeric acid
2-Oxo-3-methylpentanoic acid
2-Oxo-3-methylvalerate
2-Oxo-3-methylvaleric acid
2-Oxoisoleucine
2-oxokolavenic acid
3-Methyl-2-oxopentanoic acid
3-ethyl-3-methylpyruvic acid
3-methyl-2-oxopentanoic acid
alpha-Oxo-beta-methylvaleric acid
alpha-keto-beta-methyl-n-valeric acid
alpha-keto-beta-methylvaleric acid
alpha-oxo-beta-methyl-n-valeric acid
alpha-oxo-beta-methylvaleric acid
ketoisoleucine
hmdb:HMDB0001962
hmdb:HMDB0002254
hmdb:HMDB0003736
hmdb:HMDB0004750
hmdb:HMDB00491
hmdb:HMDB01962
hmdb:HMDB02254
hmdb:HMDB03736
hmdb:HMDB04750
chebi:1585
chebi:20116
biggM:M_3mop
keggC:M_C03465
seedM:M_cpd19026
secondary/obsolete/fantasy identifier