Feedback

2-dehydro-3-deoxy-D-gluconate

PropertiesImageOccurences in reactions
MNX_IDMNXM440Image of MNXM440
#reac
in my sandbox 0
in MNXref (generic)20
in models (compartimentalized) 10
formulaC6H9O6
charge-1
mass177.13206
referencechebi:57990
InChIKeyWPAMZTWLKIDIOP-WVZVXSGGSA-M
InChIInChI=1S/C6H10O6/c7-2-5(10)3(8)1-4(9)6(11)12/h3,5,7-8,10H,1-2H2,(H,11,12)/p-1/t3-,5+/m0/s1
SMILESOC[C@@H](O)[C@@H](O)CC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57990
chebi:57990
2-dehydro-3-deoxy-D-gluconate
2-dehydro-3-deoxy-D-gluconate anion
2-dehydro-3-deoxy-D-gluconate(1-)
3-deoxy-D-erythro-hex-2-ulosonate
bigg.metabolite:2ddglcn
biggM:2ddglcn
sabiork.compound:1973
sabiorkM:1973
2-Dehydro-3-deoxy-D-gluconate
kegg.compound:C00204
keggC:C00204
2-Dehydro-3-deoxy-D-gluconate
2-Keto-3-deoxy-D-gluconate
sabiork.compound:21127
sabiorkM:21127
2-Keto-3-deoxy-D-gluconate
2-Keto-3-deoxy-D-gluconic acid
metacyc.compound:2-DEHYDRO-3-DEOXY-D-GLUCONATE
metacycM:2-DEHYDRO-3-DEOXY-D-GLUCONATE
2-dehydro-3-deoxy-D-gluconate
2-keto-3-deoxy-D-gluconate
2-keto-3-deoxy-D-gluconic acid
2-keto-3-deoxygluconate
3-deoxy-2-oxo-D-gluconate
3-deoxy-D-erythro-hex-2-ulosonic acid
KDG
CHEBI:17032
chebi:17032
2-dehydro-3-deoxy-D-gluconic acid
2-Dehydro-3-deoxy-D-gluconate
2-Keto-3-deoxy-D-gluconate
2-dehydro-3-deoxy-D-gluconate
3-Deoxy-2-oxo-D-gluconate
3-deoxy-D-erythro-2-hexulosonic acid
3-deoxy-D-erythro-hex-2-ulosonic acid
lipidmaps:LMFA01050475
lipidmapsM:LMFA01050475
2-dehydro-3-deoxy-D-gluconic acid
3-Deoxy-2-oxo-D-gluconate
3-deoxy-D-erythro-2-hexulosonic acid
3-deoxy-D-erythro-hex-2-ulosonic acid
seed.compound:cpd00176
seedM:cpd00176
2-keto-3-deoxygluconate
2-Dehydro-3-deoxy-D-gluconate
2-Keto-3-deoxy-D-gluconate
2-dehydro-3-deoxy-D-gluconate
2-keto-3-deoxy-D-gluconate
2-keto-3-deoxy-D-gluconic acid
2ddglcn
3-deoxy-2-oxo-D-gluconate
3-deoxy-D-erythro-hex-2-ulosonic acid
KDG
chebi:1059
chebi:11550
chebi:19530
biggM:M_2ddglcn
keggC:M_C00204
seedM:M_cpd00176
secondary/obsolete/fantasy identifier