Feedback

7-oxoheptanoic acid

Properties
MNX_IDMNXM4423
formulaC7H12O3
charge0
mass144.16838
referencechebi:80588
Image of MNXM4423
InChIKeyOOFMTFUTWFAVGC-UHFFFAOYSA-N
InChIInChI=1S/C7H12O3/c8-6-4-2-1-3-5-7(9)10/h6H,1-5H2,(H,9,10)
SMILESOC(=O)CCCCCC=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models4

Similar chemical compounds in external resources
IdentifierDescription
envipath:...82a552394eb2 7-Oxoheptanoate
seedM:cpd15829 7-oxoheptanoic acid
7-Ketoheptanoic acid
7-Oxoheptanoic acid
7-oxoheptanoate
7ohp
keggC:C16590 7-Oxoheptanoic acid
7-Ketoheptanoic acid
biggM:M_7ohp
keggC:M_C16590
seedM:M_cpd15829
secondary/obsolete/fantasy identifier
chebi:80588 7-oxoheptanoic acid
7-Ketoheptanoic acid
biggM:7ohp 7-oxoheptanoic acid
metacycM:CPD-338 7-oxoheptanoate
7-oxoheptanoic acid