This is version 4.2 of MetaNetX/MNXref
 Feedback

2,3-dihydroxybenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM455Image of MNXM455
#reac
in my sandbox 0
in MNXref (generic)38
in models (compartimentalized) 6
formulaC7H5O4
charge-1
mass153.1122
referencechebi:36654
InChIKeyGLDQAMYCGOIJDV-UHFFFAOYSA-M
InChIInChI=1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11)/p-1
SMILESOc1cccc(C([O-])=O)c1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:36654
chebi:36654
2,3-dihydroxybenzoate
2,3-Dihydroxybenzoate
2-pyrocatechuate
3-hydroxysalicylate
catechol-3-carboxylate
bigg.metabolite:23dhb
biggM:23dhb
envipath:...0c111e8cc0f1
envipathM:...0c111e8cc0f1
2,3-Dihydroxybenzoate
sabiork.compound:1970
sabiorkM:1970
kegg.compound:C00196
keggC:C00196
2,3-Dihydroxybenzoate
2,3-Dihydroxybenzoic acid
seed.compound:cpd00168
seedM:cpd00168
2,3-Dihydroxybenzoate
2,3-Dihydroxybenzoic acid
2,3-dihydroxybenzoate
2,3-dihydroxybenzoic acid
2-pyrocatechuate
23dhb
3-hydroxysalicylate
catechol-3-carboxylate
metacyc.compound:2-3-DIHYDROXYBENZOATE
metacycM:2-3-DIHYDROXYBENZOATE
2,3-dihydroxybenzoate
2,3-dihydroxybenzoic acid
2-pyrocatechuate
3-hydroxysalicylate
catechol-3-carboxylate
CHEBI:18026
chebi:18026
2,3-dihydroxybenzoic acid
2,3 DHB
2,3-DIHYDROXY-BENZOIC ACID
2,3-Dihydroxybenzoic acid
2-pyrocatechuic acid
3-hydroxysalicylic acid
DOBK
catechol-3-carboxylic acid
o-pyrocatechuic acid
pyrocatechuic acid
hmdb:HMDB0000397 2-Pyrocatechuic acid
2,3 DHB
2,3-DIHYDROXY-benzoIC ACID
2,3-DIHYDROXY-benzoate
2,3-Dihydroxy benzoic acid
2,3-Dihydroxybenzoate
2,3-Dihydroxybenzoic acid
2,3-dihydroxy-benzoic acid
2,3-dihydroxybenzoic acid
2-Pyrocatechuate
2-Pyrocatechuic acid, sodium salt
3-Hydroxysalicylate
3-Hydroxysalicylic acid
Catechol-3-carboxylate
Catechol-3-carboxylic acid
Catecholcarboxylate
Catecholcarboxylic acid
DHBA
DOBK
Ferri-2,3-dihydroxybenzoic acid
O-Pyrocatechuate
O-Pyrocatechuic acid
Pyrocatechuate
Pyrocatechuic acid
envipath:...2123606e76d8
envipathM:...2123606e76d8
compound 42676
hmdb:HMDB00397
chebi:11427
chebi:19319
chebi:19320
chebi:41901
chebi:885
biggM:M_23dhb
keggC:M_C00196
seedM:M_cpd00168
secondary/obsolete/fantasy identifier