Feedback

 

2,3-dihydroxybenzoate

Image of MNXM455
Properties
MNX_IDMNXM455
formulaC7H5O4
charge-1
mass153.1127
referencechebi:36654
InChIKeyGLDQAMYCGOIJDV-UHFFFAOYSA-M
InChIInChI=1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11)/p-1
SMILESOc1cccc(C([O-])=O)c1O

This chemical compound does not exist in my selection



Occurrences of 2,3-dihydroxybenzoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:23dhb
envipath:...0c111e8cc0f1
2,3-Dihydroxybenzoate
chebi:18026
chebi:19320
chebi:41901
chebi:885
2,3 DHB
2,3-DIHYDROXY-BENZOIC ACID
2,3-Dihydroxybenzoic acid
2,3-dihydroxybenzoic acid
2-pyrocatechuic acid
3-hydroxysalicylic acid
DOBK
GLDQAMYCGOIJDV-UHFFFAOYSA-N
catechol-3-carboxylic acid
o-pyrocatechuic acid
pyrocatechuic acid
chebi:11427
chebi:19319
chebi:36654
2,3-Dihydroxybenzoate
2,3-dihydroxybenzoate
2-pyrocatechuate
3-hydroxysalicylate
GLDQAMYCGOIJDV-UHFFFAOYSA-M
catechol-3-carboxylate
envipath:...2123606e76d8 compound 42676
kegg:C00196
sabiork:1970
2,3-Dihydroxybenzoate
2,3-Dihydroxybenzoic acid
metacyc:2-3-DIHYDROXYBENZOATE 2,3-dihydroxybenzoate
2,3-dihydroxybenzoic acid
2-3-DIHYDROXYBENZOATE
2-pyrocatechuate
3-hydroxysalicylate
catechol-3-carboxylate
seed:cpd00168 2,3-Dihydroxybenzoate
2,3-Dihydroxybenzoic acid
23dhb