Feedback

butanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM458Image of MNXM458
#reac
in my sandbox 0
in MNXref (generic)66
in models (compartimentalized) 34
formulaC4H7O2
charge-1
mass87.09718
referencechebi:17968
InChIKeyFERIUCNNQQJTOY-UHFFFAOYSA-M
InChIInChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1
SMILESCCCC([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17968
chebi:17968
butanoate
1-butanoate
1-butyrate
1-propanecarboxylate
CH3-[CH2]2-COO(-)
butanate
butanoic acid, ion(1-)
butyrate
n-butanoate
n-butyrate
propanecarboxylate
propylformate
sabiork.compound:1911
sabiorkM:1911
Butanoate
Butanoic acid
Butyrate
Butyric acid
kegg.compound:C00246
keggC:C00246
Butanoic acid
Butanoate
Butyrate
Butyric acid
envipath:...eca131ec9c03
envipathM:...eca131ec9c03
Butyrate
bigg.metabolite:but
biggM:but
Butyrate (n-C4:0)
seed.compound:cpd00211
seedM:cpd00211
Butyrate
1-propanecarboxylic acid
Butanoate
Butanoic acid
Butyrate (n-C4:0)
Butyric acid
M_Butyrate
but
butanoate
butanoic acid
butyrate
butyric acid
ethylacetic acid
n-butanoate
propylformic acid
hmdb:HMDB0000039 Butyric acid
1-Butanoate
1-Butanoic acid
1-Butyrate
1-Butyric acid
1-Propanecarboxylate
1-Propanecarboxylic acid
4:0
Acid, butanoic
Acid, butyric
Acide butanoique
Acide butyrique
Butanate
Butanic acid
Butanoate
Butanoic acid
Butoate
Butoic acid
Buttersaeure
Butyrate
Butyrate, magnesium
Butyrate, sodium
Butyric acid magnesium salt
Butyric acid, sodium salt
C4:0
CH3-[CH2]2-COOH
Dibutyrate, magnesium
Ethylacetate
Ethylacetic acid
Honey robber
Kyselina maselna
Magnesium butyrate
Magnesium dibutyrate
N-Butanoate
N-Butanoic acid
N-Butyrate
N-Butyric acid
Propanecarboxylate
Propanecarboxylic acid
Propylformate
Propylformic acid
Sodium butyrate
butanoic acid
butyric acid
lipidmaps:LMFA01010004
lipidmapsM:LMFA01010004
Butyric acid
Butanoate
Butanoic acid
C4:0
Ethylacetic acid
FA(4:0)
metacyc.compound:BUTYRIC_ACID
metacycM:BUTYRIC_ACID
butanoate
1-propanecarboxylic acid
butanoic acid
butyrate
butyric acid
ethylacetic acid
n-butanoate
propylformic acid
SLM:000001195
slm:000001195
butyrate
Butanoate
reactome:R-ALL-429760
reactomeM:R-ALL-429760
reactome:R-ALL-76179
reactomeM:R-ALL-76179
CHEBI:30772
chebi:30772
butyric acid
1-butanoic acid
1-butyric acid
1-propanecarboxylic acid
4:0
BUTANOIC ACID
Butanoate
Butanoic acid
Buttersaeure
Butyric acid
C4:0
CH3-[CH2]2-COOH
acide butanoique
acide butyrique
butanic acid
butanoic acid
butoic acid
ethylacetic acid
n-butanoic acid
n-butyric acid
propanecarboxylic acid
propylformic acid
envipath:...d822f151565f
envipathM:...d822f151565f
compound 38024
hmdb:HMDB00039
chebi:113450
chebi:13924
chebi:22946
chebi:22948
chebi:3234
chebi:41208
biggM:M_but
keggC:M_C00246
seedM:M_cpd00211
secondary/obsolete/fantasy identifier