Feedback

 

oxaloacetate

Image of MNXM46
Properties
MNX_IDMNXM46
formulaC4H2O5
charge-2
mass130.0568
referencechebi:16452
InChIKeyKHPXUQMNIQBQEV-UHFFFAOYSA-L
InChIInChI=1S/C4H4O5/c5-2(4(8)9)1-3(6)7/h1H2,(H,6,7)(H,8,9)/p-2
SMILES[O-]C(=O)CC(=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of oxaloacetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:12820
chebi:14703
chebi:16452
chebi:24958
chebi:25731
chebi:29049
2-oxobutanedioate
KHPXUQMNIQBQEV-UHFFFAOYSA-L
oxalacetate
oxaloacetate
oxaloacetate dianion
oxaloacetate(2-)
oxobutanedioate
oxobutanedioic acid, ion(2-)
oxosuccinate
chebi:24959
chebi:25734
chebi:30744
chebi:7812
2-Oxobutanedioic acid
2-oxobutanedioic acid
2-oxosuccinic acid
3-carboxy-3-oxopropanoic acid
KHPXUQMNIQBQEV-UHFFFAOYSA-N
OAA
Oxalacetic acid
Oxaloacetic acid
Oxosuccinic acid
keto-succinic acid
ketosuccinic acid
oxaloacetic acid
oxobutanedioic acid
bigg:oaa
envipath:...22f2e65c38f3
Oxaloacetate
hmdb:HMDB00223 2-oxobutanedioic acid
Oxalacetic acid
oxalacetate
kegg:C00036 2-Oxobutanedioic acid
2-Oxosuccinic acid
Oxalacetic acid
Oxaloacetate
Oxaloacetic acid
keto-Oxaloacetate
lipidmaps:LMFA01170120 2-oxo-butanedioic acid
Oxalacetic acid
lipidmaps:LMFA01170120
metacyc:OXALACETIC_ACID OXALACETIC_ACID
keto-oxaloacetate
oxalacetate
oxalacetic acid
oxaloacetate
oxaloacetic acid
reactome:113587
reactome:6810070
reactome:76213
2-oxobutanedioic acid
OA
Oxalacetic acid
Oxaloacetate
Oxosuccinic acid
oxaloacetic acid
sabiork:1915 2-Oxobutanedioic acid
2-Oxosuccinate
2-oxobutanedioic acid
OAA
Oxalacetic acid
Oxaloacetate
Oxaloacetic acid
Oxosuccinic acid
keto-Oxaloacetate
seed:cpd00032 2-Oxobutanedioic acid
Oxalacetic acid
Oxaloacetate
Oxaloacetic acid
Oxosuccinic acid
keto-Oxaloacetate
oaa
deprecated:MNXM89644