Feedback

oxaloacetate

PropertiesImageOccurences in reactions
MNX_IDMNXM46Image of MNXM46
#reac
in my sandbox 0
in MNXref (generic)139
in models (compartimentalized) 99
formulaC4H2O5
charge-2
mass129.99132
referencechebi:16452
InChIKeyKHPXUQMNIQBQEV-UHFFFAOYSA-L
InChIInChI=1S/C4H4O5/c5-2(4(8)9)1-3(6)7/h1H2,(H,6,7)(H,8,9)/p-2
SMILESO=C([O-])CC(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16452
chebi:16452
oxaloacetate
2-oxobutanedioate
oxalacetate
oxaloacetate dianion
oxaloacetate(2-)
oxobutanedioate
oxobutanedioic acid, ion(2-)
oxosuccinate
hmdb:HMDB0000223 Oxalacetic acid
2 Ketosuccinic acid
2 oxo Butanedioic acid
2-Ketosuccinate
2-Ketosuccinic acid
2-Oxobutanedioate
2-Oxobutanedioic acid
2-Oxosuccinate
2-Oxosuccinic acid
2-oxo-Butanedioic acid
2-oxobutanedioic acid
3-Carboxy-3-oxopropanoate
3-Carboxy-3-oxopropanoic acid
Acid, oxalacetic
Acid, oxaloacetic
Keto-oxaloacetate
Keto-oxaloacetic acid
Keto-succinate
Keto-succinic acid
Ketosuccinate
Ketosuccinic acid
OAA
Oxalacetate
Oxaloacetate
Oxaloacetic acid
Oxaloethanoate
Oxaloethanoic acid
Oxobutanedioate
Oxobutanedioic acid
Oxosuccinate
Oxosuccinic acid
a-Ketosuccinate
a-Ketosuccinic acid
alpha-Ketosuccinate
alpha-Ketosuccinic acid
oxalacetate
lipidmaps:LMFA01170120
lipidmapsM:LMFA01170120
Oxalacetic acid
2-oxo-butanedioic acid
FA 4:2
O3
bigg.metabolite:oaa
biggM:oaa
envipath:...22f2e65c38f3
envipathM:...22f2e65c38f3
Oxaloacetate
sabiork.compound:1915
sabiorkM:1915
Oxaloacetate
2-Oxobutanedioic acid
2-Oxosuccinate
2-oxobutanedioic acid
OAA
Oxalacetic acid
Oxaloacetic acid
Oxosuccinic acid
keto-Oxaloacetate
seed.compound:cpd00032
seedM:cpd00032
Oxaloacetate
2-Oxobutanedioic acid
2-Oxosuccinic acid
Oxalacetic acid
Oxaloacetic acid
Oxosuccinic acid
keto-Oxaloacetate
keto-oxaloacetate
oaa
oxalacetate
oxalacetic acid
oxaloacetate
oxaloacetic acid
kegg.compound:C00036
keggC:C00036
Oxaloacetate
2-Oxobutanedioic acid
2-Oxosuccinic acid
Oxalacetic acid
Oxaloacetic acid
keto-Oxaloacetate
envipath:...020dbe4bdd2a
envipathM:...020dbe4bdd2a
compound 37980
envipath:...1ccdd0a2a645
envipathM:...1ccdd0a2a645
compound 468
metacyc.compound:OXALACETIC_ACID
metacycM:OXALACETIC_ACID
oxaloacetate
keto-oxaloacetate
oxalacetate
oxalacetic acid
oxaloacetic acid
reactome:R-ALL-113587
reactomeM:R-ALL-113587
reactome:R-ALL-76213
reactomeM:R-ALL-76213
CHEBI:30744
chebi:30744
oxaloacetic acid
2-Oxobutanedioic acid
2-oxobutanedioic acid
2-oxosuccinic acid
3-carboxy-3-oxopropanoic acid
OAA
Oxalacetic acid
Oxaloacetic acid
Oxosuccinic acid
keto-succinic acid
ketosuccinic acid
oxobutanedioic acid
hmdb:HMDB00223
chebi:12820
chebi:14703
chebi:24958
chebi:24959
chebi:25731
chebi:25734
chebi:7812
biggM:M_oaa
keggC:M_C00036
seedM:M_cpd00032
secondary/obsolete/fantasy identifier